CAS 23000-43-3

4-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine

Description:

4-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic organic compound characterized by its pyrazolo-pyrimidine structure, which incorporates both pyrazole and pyrimidine rings. This compound features a chlorine atom at the 4-position and a methyl group at the 1-position of the pyrazole ring. It is typically a crystalline solid, exhibiting moderate solubility in polar organic solvents. The presence of the chlorine substituent contributes to its reactivity and potential biological activity, making it of interest in medicinal chemistry and drug development. The compound may exhibit various pharmacological properties, including potential anti-inflammatory or anti-cancer activities, although specific biological effects would depend on further empirical studies. Its molecular structure allows for interactions with biological targets, which is a key consideration in the design of pharmaceuticals. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, making it a versatile building block in organic synthesis.

Formula: C₆H₅ClN₄

InChI: InChI=1/C6H5ClN4/c1-11-6-4(2-10-11)5(7)8-3-9-6/h2-3H,1H3

SMILES: Cn1c2c(cn1)c(Cl)ncn2

Synonyms:

• 1H-Pyrazolo[3,4-d]pyrimidine, 4-chloro-1-methyl-
• 4-Chloro-1-methylpyrazolo[3,4-d]pyrimidine

1H-Pyrazolo[3,4-d]pyrimidine, 4-chloro-1-methyl-

CAS: 23000-43-3

Formula: C₆H₅ClN₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 168.5837

Ref: IN-DA002LTB

4-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine

CAS: 23000-43-3

4-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine

Purity: 95%

Color and Shape: White Solid

Molecular weight: 168.58g/mol

Ref: 54-OR019232

4-Chloro-1-methyl-1H-pyrazolo[3,4-d]pyrimidine

CAS: 23000-43-3

Formula: C₆H₅ClN₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 168.58

Ref: 10-F067568