CymitQuimica logo

CAS 23000-47-7

:

1H-Pyrazolo[3,4-d]pyrimidine, 4-chloro-1-(4-methylphenyl)-

Description:
1H-Pyrazolo[3,4-d]pyrimidine, 4-chloro-1-(4-methylphenyl)-, identified by CAS number 23000-47-7, is a heterocyclic organic compound characterized by its pyrazolo and pyrimidine ring structures. This compound features a chlorine atom at the 4-position of the pyrazolo ring and a para-methylphenyl group at the 1-position, contributing to its unique chemical properties. It is typically a crystalline solid and may exhibit moderate solubility in organic solvents. The presence of the chlorine substituent can influence its reactivity and biological activity, making it of interest in medicinal chemistry and drug development. Compounds of this class are often studied for their potential pharmacological applications, including anti-inflammatory and anticancer properties. Additionally, the structural features of this compound may allow for various synthetic modifications, enhancing its utility in research and development. As with many heterocycles, it may also participate in various chemical reactions, including nucleophilic substitutions and cycloadditions, depending on the reaction conditions and the presence of other reagents.
Formula:C12H9ClN4
InChI:InChI=1S/C12H9ClN4/c1-8-2-4-9(5-3-8)17-12-10(6-16-17)11(13)14-7-15-12/h2-7H,1H3
InChI key:JJCDCMDVPYDUEU-UHFFFAOYSA-N
SMILES:CC1=CC=C(C=C1)N2C3=C(C=N2)C(=NC=N3)Cl
Found 4 products.