CAS 23002-51-9

6-Chloro-1H-pyrazolo[3,4-d]pyrimidine

Description:

6-Chloro-1H-pyrazolo[3,4-d]pyrimidine is a heterocyclic compound characterized by its fused pyrazole and pyrimidine rings, with a chlorine substituent at the 6-position. This compound typically exhibits a pale yellow to off-white crystalline appearance. It is known for its potential biological activity, particularly in medicinal chemistry, where it may serve as a scaffold for the development of various pharmaceuticals. The presence of the chlorine atom can influence its reactivity and solubility, making it a valuable intermediate in organic synthesis. Additionally, the compound may exhibit properties such as moderate to high stability under standard conditions, and it is soluble in polar organic solvents. Its unique structure allows for interactions with biological targets, which has led to research into its applications in areas such as cancer therapy and anti-inflammatory agents. As with many chemical substances, handling should be done with care, following appropriate safety protocols due to potential toxicity or reactivity.

Formula: C₅H₃ClN₄

InChI: InChI=1/C5H3ClN4/c6-5-7-1-3-2-8-10-4(3)9-5/h1-2H,(H,7,8,9,10)

SMILES: c1c2cn[nH]c2nc(Cl)n1

Synonyms:

• 1H-pyrazolo[3,4-d]pyrimidine, 6-chloro-

1H-Pyrazolo[3,4-d]pyrimidine, 6-chloro-

CAS: 23002-51-9

Formula: C₅H₃ClN₄

Purity: 96%

Color and Shape: Solid

Molecular weight: 154.5571

Ref: IN-DA002LUL

6-Chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 23002-51-9

6-Chloro-1H-pyrazolo[3,4-d]pyrimidine

Purity: 99%

Molecular weight: 154.56g/mol

Ref: 54-OR906012

6-Chloro-1H-pyrazolo[3,4-d]pyrimidine

CAS: 23002-51-9

Formula: C₅H₃ClN₄

Purity: 96%

Color and Shape: White powder

Molecular weight: 154.56

Ref: 10-F077473

6-Chloro-1H-pyrazolo[3,4-d]pyrimidine

Controlled Product

CAS: 23002-51-9

Stability Moisture Sensitive
Applications Pyrazolo[3,4-d]pyrimidines have a close structural resemblance to the substrates for the enzyme xanthine oxidase, hypoxanthine (6-hydroxypurine) and xanthine (2,6-dihydroxypurine). These compounds are capable of binding to the enzyme and strongly inhibit its activity. They have been studied for their role in the treatment and prophylaxis of hyperuricemia in human patients as well as potential anti-tumor agents.
References Massey, V., et al.: J. Biol. Chem., 245, 2837 (1970), Escribano, J., et al.: Biochem. J., 254, 829 (1988_,,,,,13) Van Hoorn, D; Eur J Pharmacol 2002, 451, 111,,14) Tamta, H; J Enzyme Inhibition Med Chem 2005, 20, 317

Formula: C₅H₃ClN₄

Color and Shape: Neat

Molecular weight: 154.56

Ref: TR-C380085