CymitQuimica logo

CAS 23002-78-0

:

1-(2-methyl-1,3-thiazol-4-yl)ethanone

Description:
1-(2-Methyl-1,3-thiazol-4-yl)ethanone, with the CAS number 23002-78-0, is an organic compound characterized by its thiazole ring structure, which contributes to its unique chemical properties. This compound features a ketone functional group, specifically an ethanone moiety, attached to a thiazole ring that contains both sulfur and nitrogen atoms. The presence of the methyl group at the 2-position of the thiazole enhances its reactivity and solubility in organic solvents. Typically, compounds like this exhibit moderate to high polarity due to the electronegative atoms in the thiazole ring, which can influence their interactions in biological systems. Additionally, thiazole derivatives are often studied for their potential biological activities, including antimicrobial and antifungal properties. The compound's stability, reactivity, and potential applications in pharmaceuticals or agrochemicals make it of interest in various fields of research. However, specific safety and handling guidelines should be followed, as with all chemical substances.
Formula:C6H7NOS
InChI:InChI=1/C6H7NOS/c1-4(8)6-3-9-5(2)7-6/h3H,1-2H3
InChI key:UJIGIKQKDDJTJL-UHFFFAOYSA-N
SMILES:CC(=O)c1csc(C)n1
Synonyms:
  • 1-(2-Methyl-1,3-thiazol-4-yl)ethanon
  • Ethanone, 1-(2-Methyl-4-Thiazolyl)-
Found 4 products.