CAS 23010-02-8
:2-(chloromethyl)but-1-ene
Description:
2-(Chloromethyl)but-1-ene is an organic compound characterized by its alkene structure, featuring a double bond between the first and second carbon atoms of a butene chain. The presence of a chloromethyl group (-CH2Cl) at the second carbon introduces a halogen substituent, which can influence the compound's reactivity and physical properties. This compound is typically a colorless to pale yellow liquid with a characteristic odor. It is soluble in organic solvents and may exhibit moderate volatility. The chloromethyl group can participate in various chemical reactions, including nucleophilic substitution and elimination reactions, making it a useful intermediate in organic synthesis. Additionally, due to the presence of the double bond, it can undergo addition reactions with various reagents. Safety considerations are important when handling this compound, as it may be harmful if inhaled or ingested, and appropriate precautions should be taken to minimize exposure. Overall, 2-(chloromethyl)but-1-ene serves as a valuable building block in the synthesis of more complex organic molecules.
Formula:C5H9Cl
InChI:InChI=1/C5H9Cl/c1-3-5(2)4-6/h2-4H2,1H3
SMILES:CCC(=C)CCl
Synonyms:- 1-Butene, 2-(chloromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-(Chloromethyl)-1-butene
CAS:Controlled ProductFormula:C5H9ClColor and Shape:NeatMolecular weight:104.58
