CAS 23012-13-7

4-Oxazolecarboxylic acid

Description:

4-Oxazolecarboxylic acid, with the CAS number 23012-13-7, is a heterocyclic organic compound characterized by the presence of an oxazole ring, which is a five-membered aromatic ring containing both nitrogen and oxygen atoms. This compound features a carboxylic acid functional group (-COOH) attached to the 4-position of the oxazole ring, contributing to its acidic properties. 4-Oxazolecarboxylic acid is typically a white to off-white solid, and it is soluble in polar solvents such as water and alcohols, owing to the presence of the carboxylic acid group. The compound is of interest in various fields, including medicinal chemistry and materials science, due to its potential biological activities and applications in synthesizing other chemical entities. Its reactivity is influenced by the electron-withdrawing nature of the oxazole ring, which can participate in various chemical reactions, including esterification and amidation. Overall, 4-oxazolecarboxylic acid serves as a valuable building block in organic synthesis and pharmaceutical development.

Formula: C₄H₃NO₃

InChI: InChI=1S/C4H3NO3/c6-4(7)3-1-8-2-5-3/h1-2H,(H,6,7)

InChI key: InChIKey=JBCFJMYPJJWIRG-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=COC=N1

Synonyms:

• 1,3-Oxazole-4-carboxylic acid
• 4-Carboxyoxazole
• 4-Oxazolecarboxylic acid

Oxazole-4-carboxylic acid

CAS: 23012-13-7

Formula: C₄H₃NO₃

Purity: 98%

Color and Shape: Solid

Molecular weight: 113.0715

Ref: IN-DA002LUZ

1,3-Oxazole-4-carboxylic acid

CAS: 23012-13-7

1,3-Oxazole-4-carboxylic acid

Formula: C₄H₃NO₃

Purity: 98%

Color and Shape: off-white solid

Molecular weight: 113.07g/mol

Ref: 54-OR6277

4-Oxazolecarboxylic Acid

CAS: 23012-13-7

Formula: C₄H₃NO₃

Purity: >98.0%(GC)(T)

Color and Shape: White to Brown powder to crystal

Molecular weight: 113.07

Ref: 3B-O0288

4-Oxazolecarboxylic acid

CAS: 23012-13-7

Formula: C₄H₃NO₃

Purity: 97%

Color and Shape: Solid

Molecular weight: 113.072

Ref: 10-F040016