CAS 2302-39-8

4,5-Dimethyl-1H-imidazole

Description:

4,5-Dimethyl-1H-imidazole is an organic compound characterized by its five-membered aromatic ring structure containing two nitrogen atoms. It features two methyl groups attached to the carbon atoms at positions 4 and 5 of the imidazole ring, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It is soluble in polar solvents such as water and alcohols, owing to the presence of nitrogen atoms that can engage in hydrogen bonding. 4,5-Dimethyl-1H-imidazole is known for its role in various chemical reactions, including its use as a building block in the synthesis of pharmaceuticals and agrochemicals. Additionally, it exhibits basic properties due to the nitrogen atoms in the ring, allowing it to act as a weak base. Its reactivity can be influenced by the presence of the methyl groups, which can affect steric hindrance and electronic distribution within the molecule. Overall, 4,5-Dimethyl-1H-imidazole is a versatile compound with applications in organic synthesis and material science.

Formula: C₅H₈N₂

InChI: InChI=1S/C5H8N2/c1-4-5(2)7-3-6-4/h3H,1-2H3,(H,6,7)

InChI key: InChIKey=YSWBFLWKAIRHEI-UHFFFAOYSA-N

SMILES: CC1=C(C)N=CN1

Synonyms:

• 1H-Imidazole, 4,5-dimethyl-
• 4,5-Dimethyl-1H-imidazole
• Imidazole, 4,5-dimethyl-
• 4,5-Dimethylimidazole

1H-Imidazole, 4,5-dimethyl-

CAS: 2302-39-8

Formula: C₅H₈N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 96.1304

Ref: IN-DA002LWK

4,5-Dimethylimidazole

CAS: 2302-39-8

4,5-Dimethylimidazole is an imidazole derivative and is widely used in biochemical experiments and drug synthesis research.

Formula: C₅H₈N₂

Purity: 98.82%

Color and Shape: Solid

Molecular weight: 96.13

Ref: TM-TN9673

4,5-Dimethylimidazole

CAS: 2302-39-8

4,5-Dimethylimidazole

Formula: C₅H₈N₂

Purity: ≥95%

Color and Shape: pale yellow to light orange crystalline solid

Molecular weight: 96.13g/mol

Ref: 54-OR471341

4,5-Dimethyl-1H-imidazole

CAS: 2302-39-8

Formula: C₅H₈N₂

Purity: ≥97%

Color and Shape: Solid

Molecular weight: 96.133

Ref: 10-F224308