CAS 2302-88-7
:Acetic acid, 2-(aminothioxomethyl)hydrazide
Description:
Acetic acid, 2-(aminothioxomethyl)hydrazide, also known by its CAS number 2302-88-7, is a chemical compound that features both acetic acid and hydrazide functional groups. This substance is characterized by its molecular structure, which includes a hydrazine moiety linked to a thioxomethyl group, contributing to its reactivity and potential applications in various chemical reactions. It typically appears as a solid or crystalline substance and is soluble in polar solvents due to the presence of the carboxylic acid group. The compound may exhibit biological activity, making it of interest in pharmaceutical and agricultural research. Its reactivity can be attributed to the presence of the hydrazide functional group, which can participate in condensation reactions and form derivatives with other electrophiles. Safety data should be consulted for handling and storage, as with any chemical, to ensure proper precautions are taken due to potential toxicity or reactivity. Overall, acetic acid, 2-(aminothioxomethyl)hydrazide represents a versatile compound in organic synthesis and medicinal chemistry.
Formula:C3H7N3OS
InChI:InChI=1S/C3H7N3OS/c1-2(7)5-6-3(4)8/h1H3,(H,5,7)(H3,4,6,8)
InChI key:InChIKey=NSIMQTOXNOFWBP-UHFFFAOYSA-N
SMILES:N(NC(N)=S)C(C)=O
Synonyms:- 1-(Acetyl)thiosemicarbazide
- 1-Acetyl-3-thiosemicarbazide
- 2-Acetylhydrazinecarbothioamide
- Acetic acid, 2-(aminothioxomethyl)hydrazide
- Acetylthiosemicarbazide
- N-Acetylthiosemicarbazide
- Nsc 202518
- Semicarbazide, 1-acetyl-3-thio-
- 1-Acetylthiosemicarbazide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Acetic acid, 2-(aminothioxomethyl)hydrazide
CAS:Formula:C3H7N3OSPurity:95%Color and Shape:SolidMolecular weight:133.17222-Acetylhydrazinecarbothioamide
CAS:2-AcetylhydrazinecarbothioamidePurity:97%Molecular weight:133.17g/molN-{[Thio(carbonoimidyl)]amino}acetamide
CAS:Formula:C3H7N3OSColor and Shape:NeatMolecular weight:133.1721-Acetyl-3-thiosemicarbazide
CAS:1-Acetyl-3-thiosemicarbazide is a reactive compound that reacts with hydroxide solution to form the corresponding thiocarbamate. 1-Acetyl-3-thiosemicarbazide is used in the synthesis of methyl ketones and triazines. The reaction of 1-acetyl-3-thiosemicarbazide with ammonia leads to the formation of an aromatic amine. This compound has been shown to be resistant to mutants that are resistant to other aliphatic hydrocarbons, such as trifluoroacetic acid and methyl chloroform.Formula:C3H7N3OSPurity:Min. 95%Color and Shape:PowderMolecular weight:133.17 g/mol2-Acetylhydrazinecarbothioamide
CAS:Formula:C3H7N3OSPurity:95%Color and Shape:SolidMolecular weight:133.17




