CAS 2302-93-4

Acetophenone, thiosemicarbazone

Description:

Acetophenone thiosemicarbazone is an organic compound derived from acetophenone and thiosemicarbazone, characterized by its thiosemicarbazone functional group. It typically appears as a solid and is known for its potential biological activities, including antimicrobial and antitumor properties. The compound features a thiosemicarbazone moiety, which is a sulfur-containing derivative of semicarbazone, contributing to its reactivity and interaction with various biological targets. Acetophenone thiosemicarbazone can participate in various chemical reactions, including condensation and coordination with metal ions, making it of interest in coordination chemistry. Its solubility varies depending on the solvent, and it is generally more soluble in polar organic solvents. The compound's structure allows for potential applications in medicinal chemistry and as a ligand in coordination complexes. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken during use.

Formula: C₉H₁₁N₃S

InChI: InChI=1S/C9H11N3S/c1-7(11-12-9(10)13)8-5-3-2-4-6-8/h2-6H,1H3,(H3,10,12,13)

InChI key: InChIKey=JMULZUQMMLAALR-UHFFFAOYSA-N

SMILES: C(=NNC(N)=S)(C)C1=CC=CC=C1

Synonyms:

• Hydrazinecarbothioamide, 2-(1-phenylethylidene)-
• 1-Phenylethanone thiosemicarbazone
• NSC 713
• 2-(1-Phenylethylidene)hydrazinecarbothioamide
• Acetophenone, thiosemicarbazone

2-(1-Phenylethylidene)hydrazinecarbothioamide

CAS: 2302-93-4

Formula: C₉H₁₁N₃S

Molecular weight: 193.2687

Ref: IN-DA002LWE

2-(1-Phenylethylidene)hydrazinecarbothioamide

CAS: 2302-93-4

2-(1-Phenylethylidene)hydrazinecarbothioamide

Purity: 95%

Molecular weight: 193.27g/mol

Ref: 54-OR1051939

Acetophenone thiosemicarbazone

CAS: 2302-93-4

Acetophenone thiosemicarbazone is a small molecule that has been shown to have potent anti-tumor activity in both cell culture and animal models. It is a cyclic peptide that binds to the DNA of tumor cells and inhibits protein synthesis, leading to cell death. Acetophenone thiosemicarbazone has also been shown to be effective against wild-type strains of bacteria such as Escherichia coli and Staphylococcus aureus. This compound is an inhibitor of efflux proteins, which are proteins that pump drugs out of bacterial cells. Acetophenone thiosemicarbazone has also been shown to inhibit RNA polymerase and other enzymes involved in DNA replication and transcription.

Formula: C₉H₁₁N₃S

Purity: Min. 95%

Molecular weight: 193.27 g/mol

Ref: 3D-CAA30293