CAS 2303-47-1
:2-Butene-1,4-diol, 1,4-dimethanesulfonate, (2Z)-
Description:
2-Butene-1,4-diol, 1,4-dimethanesulfonate, (2Z)-, with CAS number 2303-47-1, is an organic compound characterized by its dual functional groups, which include a butene structure and sulfonate moieties. This compound typically appears as a colorless to pale yellow liquid and is soluble in polar solvents due to the presence of hydroxyl and sulfonate groups. The (2Z) designation indicates the specific geometric configuration of the double bond, which influences its reactivity and interactions with other molecules. As a sulfonate ester, it can participate in various chemical reactions, including nucleophilic substitutions and hydrolysis. Its applications may extend to fields such as organic synthesis, pharmaceuticals, and materials science, where it can serve as an intermediate or a reagent. Safety data should be consulted for handling, as compounds with sulfonate groups can exhibit varying degrees of toxicity and environmental impact. Overall, 2-Butene-1,4-diol, 1,4-dimethanesulfonate is a versatile compound with significant chemical properties.
Formula:C6H12O6S2
InChI:InChI=1S/C6H12O6S2/c1-13(7,8)11-5-3-4-6-12-14(2,9)10/h3-4H,5-6H2,1-2H3/b4-3-
InChI key:InChIKey=ROPXCSBPIJQJTK-ARJAWSKDSA-N
SMILES:O(S(C)(=O)=O)C/C=C\COS(C)(=O)=O
Synonyms:- 2-Butene-1,4-diol, dimethanesulfonate, (Z)-
- 2-Butene-1,4-diol, 1,4-dimethanesulfonate, (2Z)-
- 2-Butene-1,4-diol, dimethanesulfonate, (2Z)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Cis-1,4-Bis-(Methylsulfonyloxy)-But-2-Ene
CAS:Controlled ProductFormula:C6H12O6S2Color and Shape:NeatMolecular weight:244.286
