CymitQuimica logo

CAS 23030-65-1

:

2,5-Cyclohexadiene-1,4-dione, 2-bromo-5-methoxy-

Description:
2,5-Cyclohexadiene-1,4-dione, 2-bromo-5-methoxy- is an organic compound characterized by its bicyclic structure, which features a cyclohexadiene core with two carbonyl (C=O) groups at the 1 and 4 positions, as well as a bromine atom and a methoxy group (-OCH3) at the 2 and 5 positions, respectively. This compound is likely to exhibit reactivity typical of diketones, including nucleophilic addition and condensation reactions. The presence of the bromine atom introduces electrophilic characteristics, while the methoxy group can influence the compound's electronic properties and solubility. The compound may also display interesting optical properties due to its conjugated system. Its applications could span various fields, including organic synthesis and materials science, although specific uses would depend on its reactivity and stability under different conditions. As with many organic compounds, safety precautions should be observed when handling this substance, given the potential hazards associated with brominated compounds and diketones.
Formula:C7H5BrO3
InChI:InChI=1S/C7H5BrO3/c1-11-7-3-5(9)4(8)2-6(7)10/h2-3H,1H3
InChI key:YNEPNZYQQQVSNM-UHFFFAOYSA-N
SMILES:COC1=CC(=O)C(=CC1=O)Br
Found 4 products.