CAS 2304-83-8
:1,2-Chrysenedione
Description:
1,2-Chrysenedione, with the CAS number 2304-83-8, is an organic compound that belongs to the class of polycyclic aromatic compounds. It is characterized by a fused ring structure, specifically derived from chrysene, with two carbonyl (C=O) groups located at the 1 and 2 positions of the aromatic system. This compound typically appears as a yellow to orange solid and is known for its potential applications in organic synthesis and as a precursor in the development of various organic materials. 1,2-Chrysenedione exhibits notable reactivity due to the presence of the carbonyl groups, which can participate in various chemical reactions, including nucleophilic additions and condensation reactions. Additionally, it may exhibit fluorescence properties, making it of interest in the field of materials science and photochemistry. Safety data indicates that, like many polycyclic aromatic compounds, it should be handled with care due to potential toxicity and environmental concerns.
Formula:C18H10O2
InChI:InChI=1S/C18H10O2/c19-17-10-9-15-14-6-5-11-3-1-2-4-12(11)13(14)7-8-16(15)18(17)20/h1-10H
InChI key:InChIKey=KXQDINHHHLYVOC-UHFFFAOYSA-N
SMILES:O=C1C2=C(C3=C(C=4C(C=C3)=CC=CC4)C=C2)C=CC1=O
Synonyms:- 1,2-Chrysenedione
- 1,2-Chrysoquinone
- Brn 2530139
- Ccris 2023
- Chrysene-1,2-Dione
- Chrysene-1,2-quinone
- Chrysene-1,2-quinone
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.

