CAS 2304-89-4: 3-Oxocholic acid
Description:3-Oxocholic acid, also known as 3-oxo-5β-cholanoic acid, is a bile acid derivative characterized by its steroid structure, which includes a hydroxyl group and a ketone functional group. It is a naturally occurring compound in the human body, playing a role in the metabolism of lipids and the emulsification of fats. The presence of the ketone group at the C3 position distinguishes it from other bile acids, contributing to its unique biochemical properties. This compound is typically found in bile and is involved in the digestion and absorption of dietary fats. Its solubility is influenced by the presence of hydroxyl groups, which enhance its interaction with water. 3-Oxocholic acid can also participate in various biochemical pathways, including those related to cholesterol metabolism. As a research subject, it has garnered interest for its potential implications in understanding metabolic disorders and liver function. Overall, 3-oxocholic acid is an important molecule in both physiological and pathological contexts within the field of biochemistry.
Formula:C24H38O5
InChI:InChI=1S/C24H38O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-20,22,26-27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,19-,20+,22+,23+,24-/m1/s1
InChI key:InChIKey=OEKUSRBIIZNLHZ-DJDNIQJZSA-N
SMILES:O=C(O)CCC(C)C1CCC2C3C(O)CC4CC(=O)CCC4(C)C3CC(O)C12C
- Synonyms:
- Cholan-24-oic acid, 7,12-dihydroxy-3-oxo-, (5β,7α,12α)-
- (5β,7α,12α)-7,12-Dihydroxy-3-oxocholan-24-oic acid
- 5β-Cholanic acid, 7α,12α-dihydroxy-3-oxo-
- 7α,12α-Dihydroxy-3-keto-5β-cholanic acid
- 5β-Cholan-24-oic acid, 7α,12α-dihydroxy-3-oxo-
