CAS 2304-92-9
:(5β,12α)-12-Hydroxy-3,7-dioxocholan-24-oic acid
Description:
(5β,12α)-12-Hydroxy-3,7-dioxocholan-24-oic acid, with the CAS number 2304-92-9, is a steroid compound that belongs to the class of bile acids. It is characterized by its unique structural features, including a hydroxyl group at the 12th carbon position and two keto groups at the 3rd and 7th positions of the cholane backbone. This compound is typically found in biological systems and plays a role in the metabolism of lipids. Its hydrophilic and hydrophobic regions contribute to its amphipathic nature, which is essential for its function in emulsifying fats and aiding in their absorption in the digestive system. The presence of the hydroxyl and keto groups also influences its solubility and interaction with biological membranes. As a bile acid derivative, it is involved in various physiological processes, including cholesterol homeostasis and the regulation of lipid metabolism. Understanding its characteristics is crucial for exploring its potential therapeutic applications and biological significance.
Formula:C24H36O5
InChI:InChI=1S/C24H36O5/c1-13(4-7-21(28)29)16-5-6-17-22-18(12-20(27)24(16,17)3)23(2)9-8-15(25)10-14(23)11-19(22)26/h13-14,16-18,20,22,27H,4-12H2,1-3H3,(H,28,29)/t13-,14+,16-,17+,18+,20+,22+,23+,24-/m1/s1
InChI key:InChIKey=NCQLOJDAPOEYJA-RFOIBLAWSA-N
SMILES:O=C1[C@]2([C@]3([C@@](C)([C@@]([C@@H](CCC(O)=O)C)(CC3)[H])[C@@H](O)C[C@@]2([C@]4(C)[C@](C1)(CC(=O)CC4)[H])[H])[H])[H]
Synonyms:- Cholan-24-oic acid, 12-hydroxy-3,7-dioxo-, (5β,12α)-
- 5β-Cholanic acid, 12α-hydroxy-3,7-dioxo-
- (5β,12α)-12-Hydroxy-3,7-dioxocholan-24-oic acid
- 5β-Cholan-24-oic acid, 12α-hydroxy-3,7-dioxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
