CAS 2304634-91-9: 1,1-Dimethylethyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]-1-azetidinecarboxylate
Description:1,1-Dimethylethyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]-1-azetidinecarboxylate is a complex organic compound characterized by its unique structural features, including an azetidine ring and a pyrazole moiety. The presence of a dioxaborolane group suggests potential applications in boron chemistry, particularly in catalysis or as a reagent in organic synthesis. The compound's azetidine structure contributes to its potential biological activity, as azetidines are often found in various pharmaceuticals. Additionally, the dimethyl groups provide steric hindrance, which can influence the compound's reactivity and interaction with biological targets. The overall molecular architecture indicates that it may exhibit interesting properties, such as solubility in organic solvents and stability under certain conditions. However, specific physical and chemical properties, such as melting point, boiling point, and solubility, would require experimental determination or detailed computational studies for precise characterization.
Formula:C17H28BN3O4
InChI:InChI=1S/C17H28BN3O4/c1-15(2,3)23-14(22)20-10-12(11-20)21-13(8-9-19-21)18-24-16(4,5)17(6,7)25-18/h8-9,12H,10-11H2,1-7H3
InChI key:InChIKey=OIETZNNVDLWCNR-UHFFFAOYSA-N
SMILES:O=C(OC(C)(C)C)N1CC(N2N=CC=C2B3OC(C)(C)C(O3)(C)C)C1
- Synonyms:
- 1-Azetidinecarboxylic acid, 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]-, 1,1-dimethylethyl ester
- 1,1-Dimethylethyl 3-[5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]-1-azetidinecarboxylate

tert-butyl 3-[5-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl]azetidine-1-carboxylate
Ref: IN-DA01JP8B
1g | 249.00 € | ||
5g | To inquire | ||
100mg | 57.00 € | ||
250mg | 119.00 € | ||
500mg | 179.00 € |

tert-Butyl 3-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)azetidine-1-carboxylate
Ref: 54-OR83536
1g | 495.00 € | ||
250mg | 148.00 € |

(1-(1-(TERT-BUTOXYCARBONYL)AZETIDIN-3-YL)-1H-PYRAZOL-5-YL)BORONIC ACID PINACOL ESTER
Ref: 10-F475033
1g | 257.00 € | ||
100mg | 39.00 € | ||
250mg | 76.00 € |

tert-Butyl 3-(5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazol-1-yl)azetidine-1-carboxylate
Ref: 3D-ESD63491
5g | 1,484.00 € | ||
500mg | 465.00 € |