CAS 2304635-78-5

B-(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid

Description:

B-(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid is a boronic acid derivative characterized by the presence of a boron atom bonded to a pyrrolo[2,3-b]pyridine moiety. This compound typically exhibits properties common to boronic acids, such as the ability to form reversible covalent bonds with diols, making it useful in various applications, including organic synthesis and medicinal chemistry. The presence of the methyl group on the pyrrole ring can influence its reactivity and solubility. Additionally, boronic acids are known for their role in Suzuki-Miyaura cross-coupling reactions, which are pivotal in the formation of carbon-carbon bonds. The compound may also exhibit biological activity, potentially acting as a pharmacophore in drug development. Its specific characteristics, such as melting point, solubility, and reactivity, would depend on the molecular structure and the surrounding conditions. Overall, B-(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid represents a versatile building block in synthetic chemistry and pharmaceutical research.

Formula: C₈H₉BN₂O₂

InChI: InChI=1S/C8H9BN2O2/c1-11-5-3-6-7(9(12)13)2-4-10-8(6)11/h2-5,12-13H,1H3

InChI key: InChIKey=XIWNHJLMNFUQIW-UHFFFAOYSA-N

SMILES: B(O)(O)C1=C2C(N(C)C=C2)=NC=C1

Synonyms:

• B-(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid
• Boronic acid, B-(1-methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)-

1-methyl-4-(tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrrolo[2,3-b]pyridine

CAS: 2304635-78-5

Formula: C₈H₉BN₂O₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 175.9803

Ref: IN-DA01K7V2

(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid

CAS: 2304635-78-5

(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid

Purity: 98%

Molecular weight: 175.98g/mol

Ref: 54-OR1067972

(1-Methyl-1H-pyrrolo[2,3-b]pyridin-4-yl)boronic acid

CAS: 2304635-78-5

Purity: 98%

Molecular weight: 175.9799957

Ref: 10-F692005