CAS 2305-13-7
:Dihydroconiferyl alcohol
Description:
Dihydroconiferyl alcohol, with the CAS number 2305-13-7, is a phenolic compound that is a derivative of coniferyl alcohol. It is characterized by its structure, which includes a phenolic ring and an aliphatic side chain, contributing to its reactivity and potential applications in various fields. This compound is typically found in plant materials and is involved in the biosynthesis of lignin, a critical component of plant cell walls that provides structural support. Dihydroconiferyl alcohol exhibits antioxidant properties, which may contribute to its role in plant defense mechanisms. In terms of physical properties, it is generally a colorless to pale yellow liquid or solid, depending on its purity and form. Its solubility in organic solvents makes it useful in various chemical reactions and formulations. Additionally, it has garnered interest in the field of materials science for its potential use in the development of biopolymers and other sustainable materials. Overall, dihydroconiferyl alcohol is a significant compound in both natural and synthetic chemistry contexts.
Formula:C10H14O3
InChI:InChI=1S/C10H14O3/c1-13-10-7-8(3-2-6-11)4-5-9(10)12/h4-5,7,11-12H,2-3,6H2,1H3
InChI key:InChIKey=MWOMNLDJNQWJMK-UHFFFAOYSA-N
SMILES:C(CCO)C1=CC(OC)=C(O)C=C1
Synonyms:- 1-Guaiacyl-3-propanol
- 1-Propanol, 3-(4-hydroxy-3-methoxyphenyl)-
- 3-(3-Methoxy-4-hydroxyphenyl)-1-propanol
- 3-(3-Methoxy-4-hydroxyphenyl)propanol
- 3-(4-Hydroxy-3-methoxyphenyl)-1-propanol
- 3-(4-Hydroxy-3-methoxyphenyl)propanol
- 3-(p-Hydroxy-m-methoxyphenyl)-1-propanol
- 3-Guaiacyl-1-propanol
- 4-(3-Hydroxypropyl)guaiacol
- 4-(γ-Hydroxypropyl)-2-methoxyphenol
- 4-Hydroxy-3-methoxybenzenepropanol
- 4-Propanolguaiacol
- Benzenepropanol, 4-Hydroxy-3-Methoxy-
- Coniferyl alcohol, dihydro-
- Dihydroconiferyl alcohol
- Guaiacyl-3-propanol
- Hydroconiferyl Alcohol
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
3-(4-Hydroxy-3-methoxyphenyl)-1-propanol
CAS:Formula:C10H14O3Purity:>98.0%(GC)Color and Shape:White to Almost white powder to crystalMolecular weight:182.22Dihydroconiferyl alcohol
CAS:Dihydroconiferyl alcohol analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C10H14O3Purity:(HPLC) ≥98%Color and Shape:PowderMolecular weight:182.22Dihydroconiferyl Alcohol
CAS:Formula:C10H14O3Purity:98%Color and Shape:SolidMolecular weight:182.2164Dihydroconiferyl alcohol
CAS:Dihydroconiferyl alcoholFormula:C10H14O3Purity:95%Color and Shape: white solidMolecular weight:182.22g/molDihydroconiferyl alcohol
CAS:Dihydroconiferyl alcohol promotes the growth of healing tissues and cytoprotective activity with antioxidant effects in MCF-7 cells cultured under H2O2 stress.Formula:C10H14O3Purity:99.03%Color and Shape:SolidMolecular weight:182.224-Hydroxy-3-Methoxybenzenepropanol
CAS:Controlled ProductFormula:C10H14O3Color and Shape:NeatMolecular weight:182.224-(3-Hydroxypropyl)-2-methoxyphenol
CAS:Formula:C10H14O3Purity:95%Color and Shape:SolidMolecular weight:182.219







