CAS 2305-79-5

4,5,6,7-Tetrahydro-1H-indazole

Description:

4,5,6,7-Tetrahydro-1H-indazole is a bicyclic organic compound characterized by its indazole structure, which consists of a five-membered ring fused to a six-membered ring. This compound features a saturated tetrahydro configuration, indicating the presence of four hydrogen atoms added to the indazole framework, resulting in a more stable, saturated form. It is typically a colorless to pale yellow liquid or solid, depending on its purity and form. The compound is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals due to its ability to interact with various biological targets. Its molecular formula reflects a moderate molecular weight, and it exhibits moderate solubility in organic solvents. The presence of nitrogen atoms in its structure contributes to its basicity and potential reactivity in various chemical reactions. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 4,5,6,7-Tetrahydro-1H-indazole is a compound of interest in both synthetic and medicinal chemistry.

Formula: C₇H₁₀N₂

InChI: InChI=1S/C7H10N2/c1-2-4-7-6(3-1)5-8-9-7/h5H,1-4H2,(H,8,9)

InChI key: InChIKey=GDSQTWDUCDSZEY-UHFFFAOYSA-N

SMILES: C12=C(NN=C1)CCCC2

Synonyms:

• 1H-Indazole, 4,5,6,7-tetrahydro-
• 4,5,6,7-Tetrahydro-1H-indazole
• NSC 195333
• 4,5,6,7-Tetrahydroindazole

1h-indazole, 4,5,6,7-tetrahydro-

CAS: 2305-79-5

Formula: C₇H₁₀N₂

Purity: 97%

Color and Shape: Solid

Molecular weight: 122.1677

Ref: IN-DA002M0C

4,5,6,7-Tetrahydroindazole

CAS: 2305-79-5

4,5,6,7-Tetrahydroindazole

Purity: 98%

Molecular weight: 122.17g/mol

Ref: 54-OR909279

4,5,6,7-Tetrahydro-1H-indazole

CAS: 2305-79-5

Formula: C₇H₁₀N₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 122.171

Ref: 10-F324948