CAS 23052-80-4
:3-Phosphono-L-alanine
Description:
3-Phosphono-L-alanine is an amino acid derivative characterized by the presence of a phosphonic acid group attached to the L-alanine structure. This compound features a chiral center, which contributes to its biological activity and specificity in various biochemical processes. The phosphono group enhances its solubility in water and can participate in various chemical reactions, making it a valuable compound in both research and potential therapeutic applications. It is often studied for its role in metabolic pathways and as a potential inhibitor of certain enzymes. The presence of the phosphonate moiety can also influence its interaction with biological systems, including its ability to mimic natural substrates. As a result, 3-Phosphono-L-alanine is of interest in fields such as biochemistry, pharmacology, and agricultural science, particularly in the development of herbicides or as a biochemical tool for studying metabolic processes. Its stability and reactivity under physiological conditions make it a subject of ongoing research in understanding amino acid metabolism and related biochemical pathways.
Formula:C3H8NO5P
InChI:InChI=1S/C3H8NO5P/c4-2(3(5)6)1-10(7,8)9/h2H,1,4H2,(H,5,6)(H2,7,8,9)/t2-/m0/s1
InChI key:InChIKey=LBTABPSJONFLPO-REOHCLBHSA-N
SMILES:[C@H](CP(=O)(O)O)(C(O)=O)N
Synonyms:- Alanine, 3-phosphono-, L-
- L-2-Amino-3-phosphonopropionic acid
- (R)-2-Amino-3-phosphonopropanoic acid
- 3-Phosphono-L-alanine
- L-Alanine, 3-phosphono-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 4 products.
L-AP3
CAS:L-AP3 blocks mGluR, inhibits D/L-phosphoserine (IC50: 368/2087 μM).Formula:C3H8NO5PColor and Shape:White Hygroscopic SolidMolecular weight:169.073L-AP3
CAS:Controlled ProductApplications L-AP3 is a selective antagonist of the PI-linked metabotropic glutamate response.
Formula:C3H8NO5PColor and Shape:WhiteMolecular weight:169.07



