CAS 23052-81-5: (2S)-2-Amino-4-phosphonobutanoic acid
Description:(2S)-2-Amino-4-phosphonobutanoic acid, commonly referred to as APB, is a synthetic amino acid and a phosphonic acid derivative. It is characterized by the presence of an amino group (-NH2), a carboxylic acid group (-COOH), and a phosphonate group (-PO3H2) attached to a four-carbon backbone. This compound is known for its role as a selective agonist for certain glutamate receptors, particularly the metabotropic glutamate receptor subtype 2 (mGluR2), making it of interest in neuropharmacology and research related to neurological disorders. APB is typically a white crystalline solid and is soluble in water, which facilitates its use in biological studies. Its stereochemistry, indicated by the (2S) designation, is crucial for its biological activity, as the configuration can significantly influence receptor binding and activity. Overall, (2S)-2-Amino-4-phosphonobutanoic acid serves as a valuable tool in the study of glutamatergic signaling and has potential therapeutic implications.
Formula:C4H10NO5P
InChI:InChI=1S/C4H10NO5P/c5-3(4(6)7)1-2-11(8,9)10/h3H,1-2,5H2,(H,6,7)(H2,8,9,10)/t3-/m0/s1
InChI key:InChIKey=DDOQBQRIEWHWBT-VKHMYHEASA-N
SMILES:O=C(O)C(N)CCP(=O)(O)O
- Synonyms:
- L-2-Amino-4-phosphonobutyric acid
- Butanoic acid, 2-amino-4-phosphono-, (2S)-
- Butyric acid, 2-amino-4-phosphono-, L-
- (2S)-2-Amino-4-phosphonobutanoic acid
- Butanoic acid, 2-amino-4-phosphono-, (S)-
