CAS 23056-10-2

2-amino-1,3-thiazol-5-yl thiocyanate

Description:

2-Amino-1,3-thiazol-5-yl thiocyanate is a chemical compound characterized by its thiazole ring, which contains both nitrogen and sulfur atoms, contributing to its unique properties. The presence of an amino group enhances its reactivity and solubility in polar solvents, making it useful in various chemical reactions. The thiocyanate group (-SCN) is known for its ability to form coordination complexes with metal ions, which can be exploited in analytical chemistry and coordination chemistry. This compound may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests that it could participate in nucleophilic substitution reactions due to the presence of the thiocyanate group. Additionally, the compound's stability and reactivity can be influenced by environmental factors such as pH and temperature. Overall, 2-amino-1,3-thiazol-5-yl thiocyanate is a versatile compound with applications in both research and industry, particularly in fields related to medicinal chemistry and materials science.

Formula: C₄H₃N₃S₂

InChI: InChI=1/C4H3N3S2/c5-2-8-3-1-7-4(6)9-3/h1H,(H2,6,7)

SMILES: c1c(SC#N)sc(=N)[nH]1

Thiocyanic acid, 2-​amino-​5-​thiazolyl ester

CAS: 23056-10-2

Formula: C₄H₃N₃S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.2167

Ref: IN-DA002M1Z

5-Thiocyanatothiazol-2-amine

CAS: 23056-10-2

5-Thiocyanatothiazol-2-amine

Purity: 98%

Molecular weight: 157.22g/mol

Ref: 54-OR1033697

5-Thiocyanatothiazol-2-amine

CAS: 23056-10-2

Formula: C₄H₃N₃S₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 157.21

Ref: 10-F238765

5-Thiocyanato-thiazol-2-ylamine

CAS: 23056-10-2

5-Thiocyanato-thiazol-2-ylamine is a versatile research chemical that has various applications in the field of chemistry and pharmaceuticals. It is commonly used as a building block for the synthesis of other compounds, including diclofenac, suberoylanilide hydroxamic acid, neonicotinoids, and sildenafil citrate. This compound has been extensively studied and characterized for its unique properties. It exhibits supercritical behavior under certain conditions, making it suitable for use in supercritical fluid chromatography. Additionally, 5-Thiocyanato-thiazol-2-ylamine has low refractive index and surface energy values, which make it useful in the development of coatings and materials with specific optical properties. In addition to its role as a chemical building block, this compound has also shown potential therapeutic effects. Studies have indicated that it possesses natriuretic activity, meaning it can enhance the excretion of sodium from the body. Furthermore, 5-Th

Formula: C₄H₃N₃S₂

Purity: Min. 95%

Molecular weight: 157.22 g/mol

Ref: 3D-YAA05610