CAS 23056-29-3
:N-Phenyl-4-piperidinamine
Description:
N-Phenyl-4-piperidinamine, also known by its CAS number 23056-29-3, is an organic compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. This compound features a phenyl group attached to the nitrogen of the piperidine, contributing to its aromatic properties. N-Phenyl-4-piperidinamine is typically a solid at room temperature and is soluble in organic solvents. It exhibits basic properties due to the presence of the amine functional group, allowing it to participate in various chemical reactions, such as alkylation and acylation. This compound is of interest in medicinal chemistry and pharmacology, as it may exhibit biological activity, potentially serving as a precursor or intermediate in the synthesis of pharmaceuticals. Safety data should be consulted for handling and storage, as with many amines, it may pose health risks if not managed properly. Overall, N-Phenyl-4-piperidinamine is a significant compound in organic synthesis and drug development.
Formula:C11H16N2
InChI:InChI=1S/C11H16N2/c1-2-4-10(5-3-1)13-11-6-8-12-9-7-11/h1-5,11-13H,6-9H2
InChI key:InChIKey=LKRMTUUCKBQGFO-UHFFFAOYSA-N
SMILES:N(C1=CC=CC=C1)C2CCNCC2
Synonyms:- N-(Piperidin-4-yl)aniline
- Piperidine, 4-anilino-
- 4-Piperidinamine, N-phenyl-
- N-Phenyl-4-piperidinamine
- 4-Anilinopiperidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Fentanyl Related Compound B (4-Anilinopiperidine)
CAS:Controlled ProductCompounds containing an unfused pyridine ring in the structure, nesoiFormula:C11H16N2Color and Shape:White PowderMolecular weight:176.13135


