CAS 2306262-14-4: Carbamic acid, N-[(hexahydro-1H-azepin-4-yl)methyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1)

Description:Carbamic acid, N-[(hexahydro-1H-azepin-4-yl)methyl]-, 1,1-dimethylethyl ester, hydrochloride (1:1) is a chemical compound characterized by its carbamate functional group, which is derived from carbamic acid. This compound features a hexahydro-1H-azepin moiety, indicating a cyclic amine structure that contributes to its biological activity and potential pharmacological properties. The presence of the 1,1-dimethylethyl ester group suggests that it may exhibit lipophilic characteristics, enhancing its ability to cross biological membranes. As a hydrochloride salt, it is likely to be more soluble in water, which is advantageous for formulation in pharmaceutical applications. The compound may exhibit various biological activities, potentially acting as a neurotransmitter modulator or having other therapeutic effects. Its specific interactions and efficacy would depend on its molecular structure and the presence of functional groups that can engage in hydrogen bonding, ionic interactions, or hydrophobic interactions. Further studies would be necessary to elucidate its complete profile, including stability, reactivity, and potential applications in medicinal chemistry.

Formula:C₁₂H₂₄N₂O₂·ClH

InChI:InChI=1S/C12H24N2O2.ClH/c1-12(2,3)16-11(15)14-9-10-5-4-7-13-8-6-10;/h10,13H,4-9H2,1-3H3,(H,14,15);1H

InChI key:InChIKey=CBZJAPPMQVCCFR-UHFFFAOYSA-N

SMILES:Cl.O=C(OC(C)(C)C)NCC1CCNCCC1