CAS 2307-55-3
:2,4-D Ammonium
Description:
2,4-D Ammonium, with the CAS number 2307-55-3, is a herbicide belonging to the phenoxyacetic acid family, primarily used for controlling broadleaf weeds in various agricultural settings. It is the ammonium salt form of 2,4-dichlorophenoxyacetic acid (2,4-D), which enhances its solubility and effectiveness in aqueous solutions. This compound typically appears as a white crystalline solid or powder and is known for its selective action, targeting dicotyledonous plants while being less harmful to monocots. 2,4-D Ammonium is absorbed by plants through both foliage and roots, leading to growth regulation and eventual plant death. It is commonly applied in crops such as cereals, pastures, and turf. The substance is generally considered to have low toxicity to humans and animals when used according to recommended guidelines, although it can pose risks to aquatic life. Proper handling and application are essential to minimize environmental impact and ensure safety.
Formula:C8H6Cl2O3·H3N
InChI:InChI=1S/C8H6Cl2O3.H3N/c9-5-1-2-7(6(10)3-5)13-4-8(11)12;/h1-3H,4H2,(H,11,12);1H3
InChI key:InChIKey=AQKNQRMIGNOQQF-UHFFFAOYSA-N
SMILES:O(CC(O)=O)C1=C(Cl)C=C(Cl)C=C1.N
Synonyms:- 2,4-D Ammonium salt
- Ammonium 2,4-dichlorophenoxyacetate
- (2,4-Dichlorophenoxy)acetic acid ammonium salt
- Acetic acid, 2-(2,4-dichlorophenoxy)-, ammonium salt (1:1)
- Acetic acid, (2,4-dichlorophenoxy)-, ammonium salt
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
