CAS 23073-31-6
:4-fluoro-1H-indole-3-carbaldehyde
Description:
4-Fluoro-1H-indole-3-carbaldehyde is an organic compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 4-position of the indole ring influences its electronic properties and reactivity. The aldehyde functional group at the 3-position contributes to its reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. This compound is typically a pale yellow to brown solid, and it is soluble in organic solvents such as ethanol and dichloromethane. Its reactivity can be attributed to the electrophilic nature of the aldehyde group, allowing it to participate in various chemical reactions, including condensation and nucleophilic addition. Additionally, the fluorine substituent can enhance the compound's lipophilicity and biological activity, making it of interest in medicinal chemistry. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled.
Formula:C9H6FNO
InChI:InChI=1/C9H6FNO/c10-7-2-1-3-8-9(7)6(5-12)4-11-8/h1-5,11H
SMILES:c1cc(c2c(c[nH]c2c1)C=O)F
Synonyms:- 1H-indole-3-carboxaldehyde, 4-fluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
1H-Indole-3-carboxaldehyde, 4-fluoro-
CAS:Formula:C9H6FNOPurity:97%Color and Shape:SolidMolecular weight:163.14844-Fluoro-1H-indole-3-carbaldehyde
CAS:4-Fluoro-1H-indole-3-carbaldehydePurity:98%Molecular weight:163.15g/mol4-Fluoro-1H-indole-3-carbaldehyde
CAS:4-Fluoro-1H-indole-3-carbaldehyde is a chemical compound that can be used as a reagent, reaction component, or building block in the synthesis of more complex compounds. This chemical is also known as CAS No. 23073-31-6 and has high quality and purity. 4-Fluoro-1H-indole-3-carbaldehyde is useful for research purposes and can be used as a speciality chemical or a fine chemical.
Formula:C9H6FNOPurity:Min. 95%Color and Shape:Yellow To Brown SolidMolecular weight:163.15 g/mol4-Fluoro-1H-indole-3-carbaldehyde
CAS:Formula:C9H6FNOPurity:98%Color and Shape:SolidMolecular weight:163.151



