CAS 23077-43-2

5-Fluoro-1H-indole-3-carboxylic acid

Description:

5-Fluoro-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which consists of a fused benzene and pyrrole ring. The presence of a fluorine atom at the 5-position and a carboxylic acid group at the 3-position contributes to its unique properties. This compound is typically a white to off-white solid and is soluble in polar solvents, such as water and alcohols, due to the carboxylic acid functionality. It exhibits acidic behavior, allowing it to participate in various chemical reactions, including esterification and amidation. The fluorine substitution can enhance the compound's biological activity and lipophilicity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting various diseases. Additionally, 5-Fluoro-1H-indole-3-carboxylic acid can serve as a building block in organic synthesis, facilitating the creation of more complex molecules. Its stability and reactivity make it a valuable compound in both academic and industrial chemistry settings.

Formula: C₉H₆FNO₂

InChI: InChI=1S/C9H6FNO2/c10-5-1-2-8-6(3-5)7(4-11-8)9(12)13/h1-4,11H,(H,12,13)

InChI key: InChIKey=SDZBAXLIHRBNOV-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C=2C(NC1)=CC=C(F)C2

Synonyms:

• 1H-Indole-3-carboxylic acid, 5-fluoro-
• 5-Fluoro-1H-indole-3-carboxylic acid
• Indole-3-carboxylic acid, 5-fluoro-
• 5-Fluoroindole-3-carboxylic acid

1H-Indole-3-carboxylic acid, 5-fluoro-

CAS: 23077-43-2

Formula: C₉H₆FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.1478

Ref: IN-DA002M5A

5-Fluoro-1H-indole-3-carboxylic acid

CAS: 23077-43-2

5-Fluoro-1H-indole-3-carboxylic acid

Purity: 95%

Molecular weight: 179.15g/mol

Ref: 54-PC201206

5-Fluoro-1H-indole-3-carboxylic acid

CAS: 23077-43-2

Formula: C₉H₆FNO₂

Purity: 95%

Color and Shape: Solid

Molecular weight: 179.15

Ref: 10-F209797