CAS 23077-44-3: 6-Fluoro-1H-indole-3-carboxylic acid

Description:6-Fluoro-1H-indole-3-carboxylic acid is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a fluorine atom at the 6-position of the indole ring introduces unique electronic and steric properties, potentially influencing its reactivity and biological activity. The carboxylic acid functional group at the 3-position contributes to its acidity and solubility in polar solvents. This compound is of interest in medicinal chemistry and drug development due to its potential pharmacological properties, including antimicrobial and anti-inflammatory activities. Its molecular structure allows for various synthetic modifications, making it a versatile building block in organic synthesis. Additionally, the compound's stability and reactivity can be influenced by the presence of the fluorine atom, which can enhance lipophilicity and alter interaction with biological targets. Overall, 6-Fluoro-1H-indole-3-carboxylic acid serves as a valuable compound in research and development within the fields of chemistry and pharmacology.

Formula:C₉H₆FNO₂

InChI:InChI=1S/C9H6FNO2/c10-5-1-2-6-7(9(12)13)4-11-8(6)3-5/h1-4,11H,(H,12,13)

InChI key:InChIKey=ITDFSNLFIZWJDB-UHFFFAOYSA-N

SMILES:O=C(O)C1=CNC=2C=C(F)C=CC21

Synonyms:
1H-Indole-3-carboxylic acid, 6-fluoro-
Indole-3-carboxylic acid, 6-fluoro-
6-Fluoro-1H-indole-3-carboxylic acid
6-Fluoroindole-3-carboxylic acid

Found 4 products.

Product data	Purity	Price range	Estimated delivery
1H-Indole-3-carboxylic acid, 6-fluoro- REF: IN-DA002M59CAS: 23077-44-3	98%	32.00 €~541.00 €	Wed 26 Mar 25
6-Fluoro-1H-indole-3-carboxylic acid REF: 10-F376496CAS: 23077-44-3	95.0%	27.00 €~1,361.00 €	Mon 31 Mar 25
6-Fluoro-1H-indole-3-carboxylic acid REF: 54-PC906871CAS: 23077-44-3	98%	113.00 €~439.00 €	Wed 02 Apr 25
6-Fluoro-1H-Indole-3-Carboxylic Acid REF: 3D-FF82816CAS: 23077-44-3	Min. 95%	- - -	Discontinued product