CAS 23079-73-4

3-Bromo-2,4,6-trimethylpyridine

Description:

3-Bromo-2,4,6-trimethylpyridine is an organic compound belonging to the pyridine family, characterized by a six-membered aromatic ring containing one nitrogen atom. Its molecular structure features three methyl groups attached to the 2, 4, and 6 positions of the pyridine ring, along with a bromine substituent at the 3-position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its distinctive aromatic odor and is soluble in organic solvents. 3-Bromo-2,4,6-trimethylpyridine is utilized in various chemical syntheses and as an intermediate in the production of pharmaceuticals and agrochemicals. Its reactivity is influenced by the presence of the bromine atom, which can participate in nucleophilic substitution reactions. Additionally, the methyl groups contribute to the compound's steric hindrance, affecting its chemical behavior and interactions. Safety precautions should be taken when handling this compound, as it may pose health risks upon exposure.

Formula: C₈H₁₀BrN

InChI: InChI=1/C8H10BrN/c1-5-4-6(2)10-7(3)8(5)9/h4H,1-3H3

SMILES: Cc1cc(C)nc(C)c1Br

Synonyms:

• 3-Bromo-2,4,6-collidine

3-Bromo-2,4,6-trimethylpyridine

CAS: 23079-73-4

Formula: C₈H₁₀BrN

Purity: 95%

Color and Shape: Liquid

Molecular weight: 200.0757

Ref: IN-DA00BFI8

3-Bromo-2,4,6-trimethylpyridine

CAS: 23079-73-4

3-Bromo-2,4,6-trimethylpyridine

Purity: 98%

Molecular weight: 200.08g/mol

Ref: 54-OR315117

3-Bromo-2,4,6-trimethylpyridine

CAS: 23079-73-4

Formula: C₈H₁₀BrN

Purity: ≥95%

Molecular weight: 200.079

Ref: 10-F228912

3-Bromo-2,4,6-trimethylpyridine

Controlled Product

CAS: 23079-73-4

Applications 3-Bromo-2,4,6-trimethylpyridine

Formula: C₈H₁₀BrN

Color and Shape: Neat

Molecular weight: 200.08

Ref: TR-B688713