CAS 2308-61-4
:3,6-Dibenzyl-2,5-dioxopiperazine
Description:
3,6-Dibenzyl-2,5-dioxopiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features two benzyl groups attached to the 3 and 6 positions of the piperazine ring, contributing to its structural complexity and potential for various interactions. The presence of the dioxo functional groups at the 2 and 5 positions indicates that it contains two carbonyl groups, which can participate in hydrogen bonding and other chemical reactions. This compound is typically used in organic synthesis and may exhibit biological activity, making it of interest in medicinal chemistry. Its properties, such as solubility, melting point, and reactivity, can vary based on the specific conditions and solvents used. As with many organic compounds, safety precautions should be taken when handling it, as it may pose health risks or environmental hazards. Overall, 3,6-Dibenzyl-2,5-dioxopiperazine is a versatile compound with potential applications in various fields of chemistry.
Formula:C18H18N2O2
InChI:InChI=1S/C18H18N2O2/c21-17-15(11-13-7-3-1-4-8-13)19-18(22)16(20-17)12-14-9-5-2-6-10-14/h1-10,15-16H,11-12H2,(H,19,22)(H,20,21)
InChI key:InChIKey=JUAPMRSLDANLAS-UHFFFAOYSA-N
SMILES:C(C1C(=O)NC(CC2=CC=CC=C2)C(=O)N1)C3=CC=CC=C3
Synonyms:- 3,6-Bis(phenylmethyl)-2,5-piperazinedione
- 2,5-Piperazinedione, 3,6-bis(phenylmethyl)-
- 3,6-Dibenzyl-2,5-piperazinedione
- 3,6-Dibenzyl-2,5-dioxopiperazine
- 2,5-Piperazinedione, 3,6-dibenzyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
3,6-Dibenzylpiperazine-2,5-dione
CAS:Controlled ProductApplications 3,6-Dibenzylpiperazine-2,5-dione is a new class of anthelmintics. 3,6-Dibenzylpiperazine-2,5-dione is a dipeptide metabolites from the broth of marine fungus Aspergillus specie. 3,6-Dibenzylpiperazine-2,5-dione is a secondary metabolites of Aspergillus awamori F12 isolated from rhizosphere soil of Rhizophora stylosa Griff that exhibits antibacterial properties.
References Walchshofer, N., et al.: Amino Acids, 12, 41 (1997); Chang, M., et al.: Weishengwu Xuebao, 50, 1385 (2010); Huang, Y., et al.: Zhongguo Yaowu Huaxue Zazhi, 16, 37 (2006)Formula:C18H18N2O2Color and Shape:NeatMolecular weight:294.348


