CAS 23094-96-4
:3-bromo-4-methoxybenzenesulfonyl chloride
Description:
3-Bromo-4-methoxybenzenesulfonyl chloride, with the CAS number 23094-96-4, is an organic compound characterized by the presence of a sulfonyl chloride functional group attached to a benzene ring that also features a bromine atom and a methoxy group. This compound typically appears as a solid or crystalline substance and is known for its reactivity, particularly due to the sulfonyl chloride moiety, which can participate in nucleophilic substitution reactions. The bromine atom introduces a halogen, which can enhance the electrophilicity of the aromatic ring, making it a useful intermediate in organic synthesis. The methoxy group serves as an electron-donating substituent, influencing the compound's reactivity and stability. 3-Bromo-4-methoxybenzenesulfonyl chloride is often utilized in the synthesis of various pharmaceuticals and agrochemicals, as well as in the preparation of sulfonamide derivatives. Proper handling and storage are essential due to its potential reactivity and the need for safety precautions when working with sulfonyl chlorides.
Formula:C7H6BrClO3S
InChI:InChI=1/C7H6BrClO3S/c1-12-7-3-2-5(4-6(7)8)13(9,10)11/h2-4H,1H3
SMILES:COc1ccc(cc1Br)S(=O)(=O)Cl
Synonyms:- 3-Bromo-4-methoxy-benzenesulfonyl chloride
- Benzenesulfonyl chloride, 3-bromo-4-methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
3-Bromo-4-methoxybenzenesulfonyl chloride, 97%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6BrClO3SPurity:97%Molecular weight:285.54Benzenesulfonyl chloride, 3-bromo-4-methoxy-
CAS:Formula:C7H6BrClO3SPurity:97%Color and Shape:SolidMolecular weight:285.54273-Bromo-4-methoxy-benzenesulfonyl chloride
CAS:3-Bromo-4-methoxy-benzenesulfonyl chloridePurity:96%Color and Shape:Off-White SolidMolecular weight:285.54g/mol3-Bromo-4-methoxybenzenesulfonyl chloride
CAS:Formula:C7H6BrClO3SPurity:97%Color and Shape:Low Melting SolidMolecular weight:285.54



