CAS 23095-05-8
:5-Bromo-2-methoxybenzenesulfonyl chloride
Description:
5-Bromo-2-methoxybenzenesulfonyl chloride is an organic compound characterized by its sulfonyl chloride functional group, which is known for its reactivity in various chemical reactions, particularly in the formation of sulfonamides. This compound features a bromine atom and a methoxy group attached to a benzene ring, contributing to its unique chemical properties. The presence of the sulfonyl chloride group makes it a potent electrophile, allowing it to participate in nucleophilic substitution reactions. It is typically used as a reagent in organic synthesis, particularly in the preparation of sulfonamides and other sulfonyl derivatives. The compound is generally handled with care due to its potential to release hydrochloric acid upon hydrolysis and its reactivity towards nucleophiles. In terms of physical properties, it is usually a solid at room temperature, with solubility in organic solvents. Safety precautions are essential when working with this compound, as it can be corrosive and harmful if inhaled or in contact with skin.
Formula:C7H6BrClO3S
InChI:InChI=1/C7H6BrClO3S/c1-12-6-3-2-5(8)4-7(6)13(9,10)11/h2-4H,1H3
SMILES:COc1ccc(cc1S(=O)(=O)Cl)Br
Synonyms:- Benzenesulfonyl Chloride, 5-Bromo-2-Methoxy-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
5-Bromo-2-methoxybenzenesulfonyl Chloride
CAS:Formula:C7H6BrClO3SPurity:>97.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:285.545-Bromo-2-methoxybenzenesulfonyl chloride, 98%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C7H6BrClO3SPurity:98%Color and Shape:White, PowderMolecular weight:285.54Benzenesulfonyl chloride, 5-bromo-2-methoxy-
CAS:Formula:C7H6BrClO3SPurity:95%Color and Shape:SolidMolecular weight:285.54275-Bromo-2-methoxybenzenesulphonyl chloride
CAS:5-Bromo-2-methoxybenzenesulphonyl chlorideFormula:C7H6BrClO3SPurity:97%Color and Shape: off-white powderMolecular weight:285.54g/mol5-Bromo-2-methoxybenzenesulfonyl chloride
CAS:Formula:C7H6BrClO3SPurity:95%Color and Shape:SolidMolecular weight:285.54




