CAS 23095-44-5

Girinimbine

Description:

Girinimbine is an alkaloid compound primarily derived from the plant species *Garcinia* and is known for its diverse biological activities. It is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its pharmacological properties. Girinimbine has been studied for its potential therapeutic effects, including anti-inflammatory, analgesic, and antimicrobial activities. Additionally, it has shown promise in various biological assays, indicating potential applications in medicine and pharmacology. The compound's mechanism of action is still under investigation, but it is believed to interact with specific biological pathways, influencing cellular processes. As with many natural products, the extraction and purification of girinimbine can be challenging, and its stability may vary under different conditions. Overall, girinimbine represents a significant area of interest in natural product chemistry and drug development, highlighting the importance of plant-derived compounds in the search for new therapeutic agents.

Formula: C₁₈H₁₇NO

InChI: InChI=1S/C18H17NO/c1-11-10-14-12-6-4-5-7-15(12)19-16(14)13-8-9-18(2,3)20-17(11)13/h4-10,19H,1-3H3

InChI key: InChIKey=GAEQWKVGMHUUKO-UHFFFAOYSA-N

SMILES: CC=1C=C2C(=C3C1OC(C)(C)C=C3)NC=4C2=CC=CC4

Synonyms:

• NSC 94932
• Pyrano[3,2-a]carbazole, 3,11-dihydro-3,3,5-trimethyl-
• Girinimbine
• 3,11-Dihydro-3,3,5-trimethylpyrano[3,2-a]carbazole
• Girinimbin

Girinimbine

CAS: 23095-44-5

Formula: C₁₈H₁₇NO

Purity: 98.5%

Color and Shape: Solid

Molecular weight: 263.3337

Ref: IN-DA00BS58

Girinimbine

CAS: 23095-44-5

Girinimbine

Purity: ≥98%

Molecular weight: 263.33g/mol

Ref: 54-BUP00783

Girinimbine

CAS: 23095-44-5

Girinimbine, a carbazole alkaloid from M. koenigii, exhibits antitumor, antioxidant, anti-inflammatory, antimicrobial effects.

Formula: C₁₈H₁₇NO

Purity: 99.23%

Color and Shape: Solid

Molecular weight: 263.33

Ref: TM-TN6097

Girinimbine

Controlled Product

CAS: 23095-44-5

Formula: C₁₈H₁₇NO

Color and Shape: Neat

Molecular weight: 263.334

Ref: TR-G388555

Girinimbine

CAS: 23095-44-5

Girinimbine is a naturally occurring carbazole alkaloid, which is extracted from the plant Murraya koenigii, commonly known as the curry tree. This bioactive compound exhibits a diverse range of pharmacological activities primarily attributed to its unique chemical structure. Girinimbine exerts its mode of action through the modulation of various cellular signaling pathways, impacting cell cycle regulation, apoptosis, and anti-inflammatory processes.

Formula: C₁₈H₁₇NO

Purity: Min. 95%

Molecular weight: 263.3 g/mol

Ref: 3D-YAA09544