CAS 231-23-2
:pyrazino[2,3-f]quinoxaline
Description:
Pyrazino[2,3-f]quinoxaline is a heterocyclic compound characterized by its fused pyrazine and quinoxaline rings. It typically exhibits a planar structure, which contributes to its potential for π-π stacking interactions, making it interesting for various applications in materials science and medicinal chemistry. The compound is known for its biological activity, particularly in the field of pharmacology, where it has been investigated for its potential as an antitubercular agent. Its chemical properties include moderate solubility in organic solvents and relatively low solubility in water, which can influence its bioavailability and interaction with biological systems. The presence of nitrogen atoms in its structure can also impart unique electronic properties, making it a candidate for further research in drug development and organic electronics. Overall, pyrazino[2,3-f]quinoxaline is a compound of interest due to its structural characteristics and potential applications in various scientific fields.
Formula:C10H6N4
InChI:InChI=1/C10H6N4/c1-2-8-10(14-6-4-12-8)9-7(1)11-3-5-13-9/h1-6H
SMILES:c1cc2c(c3c1nccn3)nccn2
Synonyms:- 1,4,5,8-Tetraaza-phenanthrene
- Pyrazino[2,3-f]quinoxaline
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Pyrazino[2,3-f]quinoxaline
CAS:Controlled ProductFormula:C10H6N4Color and Shape:NeatMolecular weight:182.181

