CAS 23102-92-3
:D-glycero-L-gluco-Heptose
Description:
D-glycero-L-gluco-heptose is a seven-carbon sugar, specifically a heptose, that plays a significant role in the structure of certain bacterial polysaccharides and lipopolysaccharides. It is an aldoheptose, meaning it contains an aldehyde functional group and has a specific stereochemistry that contributes to its biological functions. This compound is characterized by its ability to participate in various biochemical pathways, particularly in the synthesis of glycoproteins and glycolipids. D-glycero-L-gluco-heptose is often found in the outer membrane of Gram-negative bacteria, where it contributes to the structural integrity and immunogenic properties of the bacterial cell wall. Its unique configuration allows it to interact with specific receptors in host organisms, influencing immune responses. The compound is typically soluble in water, and its reactivity can be influenced by the presence of hydroxyl groups, which can participate in hydrogen bonding and other interactions. Overall, D-glycero-L-gluco-heptose is an important sugar in microbiology and biochemistry, with implications for understanding bacterial pathogenesis and host interactions.
Formula:C7H14O7
InChI:InChI=1S/C7H14O7/c8-1-3(10)5(12)7(14)6(13)4(11)2-9/h1,3-7,9-14H,2H2/t3-,4-,5+,6+,7-/m1/s1
InChI key:InChIKey=YPZMPEPLWKRVLD-ULQPCXBYSA-N
SMILES:[C@H]([C@H]([C@@H](CO)O)O)([C@H]([C@@H](C=O)O)O)O
Synonyms:- <span class="text-smallcaps">D</smallcap>-galacto(<smallcap>L</span>-gluco)-Heptose
- <span class="text-smallcaps">D</smallcap>-glycero-<smallcap>L</span>-gluco-Heptose
- Beta-D-Galactoheptose
- Ss-D-Galactoheptose
- b-D-Galactoheptose
- D-glycero-L-gluco-Heptose
- D-galacto(L-gluco)-Heptose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 2 products.
b-D-Galactoheptose
CAS:B-D-Galactoheptose is a short-chain carbohydrate that is found in Citrus. It can be used as a food additive, but it also serves as an intermediate in the synthesis of other sugars. The stereospecificity of this sugar is determined by the orientation of its hydroxyl group on carbon atom 2. This sugar has been shown to inhibit the growth of food-borne pathogens, such as Salmonella and Staphylococcus, and has been shown to have anti-inflammatory properties. The biosynthesis of b-D-galactoheptose begins with the conversion of glucose into erythrose 4 phosphate. This process requires ATP and pyruvate kinase and proceeds through two reactions: erythrose 4 phosphate dehydrogenase, which converts erythrose 4 phosphate into erythronate 4 phosphate; and aldolase, which converts erythronate 4 phosphate into b-DFormula:C7H14O7Purity:Min. 95%Color and Shape:PowderMolecular weight:210.18 g/mol

