
CAS 23111-00-4
:Pyridinium, 3-(aminocarbonyl)-1-β-D-ribofuranosyl-, chloride (1:1)
Description:
Pyridinium, 3-(aminocarbonyl)-1-β-D-ribofuranosyl-, chloride (1:1), commonly referred to as a pyridinium derivative, is a chemical compound characterized by its pyridine ring structure and a ribofuranosyl moiety. This compound features an aminocarbonyl group, which contributes to its potential biological activity, particularly in the context of nucleoside analogs. The presence of the chloride ion indicates that it exists as a salt, which can influence its solubility and stability in various solvents. Pyridinium derivatives are often studied for their roles in medicinal chemistry, as they can exhibit antiviral, antibacterial, or anticancer properties. The ribofuranosyl component suggests that this compound may interact with nucleic acids or enzymes involved in nucleic acid metabolism. Its molecular structure allows for hydrogen bonding and other interactions that can affect its reactivity and biological function. Overall, this compound is of interest in both synthetic and medicinal chemistry due to its unique structural features and potential applications.
Formula:C11H15N2O5·Cl
InChI:InChI=1S/C11H14N2O5.ClH/c12-10(17)6-2-1-3-13(4-6)11-9(16)8(15)7(5-14)18-11;/h1-4,7-9,11,14-16H,5H2,(H-,12,17);1H/t7-,8-,9-,11-;/m1./s1
InChI key:InChIKey=YABIFCKURFRPPO-IVOJBTPCSA-N
SMILES:O[C@H]1[C@@H](O[C@H](CO)[C@H]1O)[N+]=2C=C(C(N)=O)C=CC2.[Cl-]
Synonyms:- N-Ribosylnicotinamide chloride
- Nr-Cl
- Pyridinium, 3-(aminocarbonyl)-1-β-<span class="text-smallcaps">D</span>-ribofuranosyl-, chloride
- Pyridinium, 3-(aminocarbonyl)-1-β-<span class="text-smallcaps">D</span>-ribofuranosyl-, chloride (1:1)
- Pyridinium, 3-carbamoyl-1-β-<span class="text-smallcaps">D</span>-ribofuranosyl-, chloride
- Nicotinamide riboside chloride
- Pyridinium, 3-(aminocarbonyl)-1-β-D-ribofuranosyl-, chloride
- Pyridinium, 3-(aminocarbonyl)-1-β-D-ribofuranosyl-, chloride (1:1)
- Pyridinium, 3-carbamoyl-1-β-D-ribofuranosyl-, chloride
- icotinamide riboside chloride
- Nicotinamide Riboside Chloride NR-CL Powder
- 3-carbamoyChemicalbookl-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyridin-1-iumchloride
- b-Nicotinamide riboside chloride
- Nicotinamide riboside chloride USP/EP/BP
- Nicotinamide riboside chloride NR-CL
- Nicotinamide Riboside Chloride,99%
- nicotinamide riboside chloride powder(NRC)
- Nicotinamide ribose chloride
- 3-carbamoyl-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyridin-1-ium chloride
- β-nicotinamide riboside chloride
- 1-ribosylnicotinamide chloride
- 99% purity Nicotinamide riboside chloride
- 3-Carbamoyl-1-(β-D-ribofuranosyl)pyridinium chloride
- Nicotimide riboside chloride
- 3-Carbamoyl-1-beta-D-ribofuranosylpyridinium chloride
- Nicotinamide Riboside.Cl
- High Quality Nicotinamide riboside chloride
- Nicotinamide B-D Riboside Chloride(WX900111)
- Cas23111-00-4 NR-CL, nacl
- NRC
- Nicotinamide Riboside Chloride(NRC)
- Nicotinamide riboside chloride CAS 23111 00 4
- NRC /Nicotinamide Riboside Chloride
- API Nicotinamide riboside chloride Powder
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Nicotinamide Riboside Chloride
CAS:Nucleic acids and their salts, whether or not chemically defined; other heterocyclic compounds, nesoiFormula:C11H15ClN2O5Color and Shape:White Off-White PowderMolecular weight:290.066953-Carbamoyl-1-((2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)tetrahydrofuran-2-yl)pyridin-1-ium chloride
CAS:Formula:C11H15ClN2O5Purity:97%Color and Shape:SolidMolecular weight:290.7002Nicotinamide-β-D-riboside chloride
CAS:Nicotinamide-β-D-riboside chlorideFormula:C11H15N2O5·ClPurity:98%Color and Shape: white solidMolecular weight:290.7002g/molNicotinamide riboside chloride
CAS:Nicotinamide riboside chloridePurity:≥98%Molecular weight:290.7g/molNicotinamide riboside chloride
CAS:<p>NR, also SRT647, is a B3 vitamin form; precursor to NAD+.</p>Formula:C11H15ClN2O5Purity:98.92% - 99.86%Color and Shape:SolidMolecular weight:290.73-CARBAMOYL-1-((2R,3R,4S,5R)-3,4-DIHYDROXY-5-(HYDROXYMETHYL)TETRAHYDROFURAN-2-YL)PYRIDIN-1-IUM CHLORIDE
CAS:Purity:97%Molecular weight:290.7000122Nicotinamide Riboside Chloride extrapure, 97%
CAS:Formula:C11H15N2O5ClPurity:min. 97%Color and Shape:White to off-white, Powder, Clear, Colourless to pale yellowMolecular weight:290.70










