CymitQuimica logo

CAS 23113-01-1

:

4-amino-1-[5-O-(tricyclo[3.3.1.1~3,7~]dec-1-ylcarbonyl)-beta-D-arabinofuranosyl]pyrimidin-2(1H)-one

Description:
4-amino-1-[5-O-(tricyclo[3.3.1.1~3,7~]dec-1-ylcarbonyl)-beta-D-arabinofuranosyl]pyrimidin-2(1H)-one, with CAS number 23113-01-1, is a complex organic compound characterized by its unique structural features. It contains a pyrimidinone core, which is a six-membered aromatic ring with nitrogen atoms, contributing to its potential biological activity. The presence of an amino group enhances its reactivity and may influence its interaction with biological targets. The compound also features a beta-D-arabinofuranosyl moiety, which is a sugar derivative that can play a crucial role in biological recognition processes. Additionally, the tricyclic structure contributes to the compound's rigidity and may affect its pharmacokinetic properties. This compound is of interest in medicinal chemistry, particularly for its potential applications in antiviral or anticancer therapies, owing to its structural complexity and the presence of functional groups that can participate in various biochemical interactions. Overall, its unique combination of features makes it a subject of research in the field of drug development.
Formula:C20H27N3O6
InChI:InChI=1/C20H27N3O6/c21-14-1-2-23(19(27)22-14)17-16(25)15(24)13(29-17)9-28-18(26)20-6-10-3-11(7-20)5-12(4-10)8-20/h1-2,10-13,15-17,24-25H,3-9H2,(H2,21,22,27)/t10?,11?,12?,13-,15-,16+,17-,20?/m1/s1
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.