CymitQuimica logo

CAS 23116-76-9

:

1-[5-(1-{[2-amino-5-(carbamoyloxy)-3,4-dihydroxypentanoyl]amino}-2-[(3Z)-2-carboxy-3-ethylideneazetidin-1-yl]-2-oxoethyl)-3,4-dihydroxytetrahydrofuran-2-yl]-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid (non-preferred name)

Description:
The chemical substance with the name "1-[5-(1-{[2-amino-5-(carbamoyloxy)-3,4-dihydroxypentanoyl]amino}-2-[(3Z)-2-carboxy-3-ethylideneazetidin-1-yl]-2-oxoethyl)-3,4-dihydroxytetrahydrofuran-2-yl]-2,4-dioxo-1,2,3,4-tetrahydropyrimidine-5-carboxylic acid" and CAS number 23116-76-9 is a complex organic compound characterized by multiple functional groups and a multi-ring structure. It features a tetrahydropyrimidine core, which is indicative of its potential biological activity, possibly as a pharmaceutical agent. The presence of amino, hydroxyl, and carboxylic acid groups suggests it may exhibit polar characteristics, enhancing its solubility in aqueous environments. Additionally, the compound's intricate structure implies potential interactions with biological macromolecules, such as proteins or nucleic acids, which could be relevant for its pharmacological properties. Its synthesis and stability may be influenced by the presence of various substituents, which can affect its reactivity and bioavailability. Overall, this compound represents a significant interest in medicinal chemistry, particularly in the development of therapeutic agents.
Formula:C23H30N6O15
InChI:InChI=1/C23H30N6O15/c1-2-6-3-28(11(6)21(39)40)18(36)10(26-17(35)9(24)12(31)8(30)5-43-22(25)41)15-13(32)14(33)19(44-15)29-4-7(20(37)38)16(34)27-23(29)42/h2,4,8-15,19,30-33H,3,5,24H2,1H3,(H2,25,41)(H,26,35)(H,37,38)(H,39,40)(H,27,34,42)/b6-2-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
  • Polyoxin F

    CAS:
    <p>Polyoxin F is a nucleoside-type antifungal antibiotic that demonstrates significant effectiveness against rice sheath blight disease.</p>
    Formula:C23H30N6O15
    Color and Shape:Solid
    Molecular weight:630.52