CAS 2312-15-4
:4-(Dodecyloxy)benzoic acid
Description:
4-(Dodecyloxy)benzoic acid, with the CAS number 2312-15-4, is an organic compound characterized by its long hydrophobic dodecyloxy chain attached to a benzoic acid moiety. This structure imparts amphiphilic properties, making it soluble in both organic solvents and water to some extent, depending on the conditions. The presence of the carboxylic acid group (-COOH) allows for potential hydrogen bonding and contributes to its acidity, which can influence its behavior in various chemical environments. This compound is often utilized in the study of liquid crystals and surfactants due to its ability to form organized structures in solution. Its hydrophobic tail enhances its ability to interact with lipid membranes, making it of interest in biological and materials science applications. Additionally, the compound may exhibit unique thermal and optical properties, which are valuable in the development of advanced materials. Overall, 4-(Dodecyloxy)benzoic acid serves as a significant model compound in the exploration of molecular interactions and self-assembly processes.
Formula:C19H30O3
InChI:InChI=1S/C19H30O3/c1-2-3-4-5-6-7-8-9-10-11-16-22-18-14-12-17(13-15-18)19(20)21/h12-15H,2-11,16H2,1H3,(H,20,21)
InChI key:InChIKey=ALQLYJHDBAKLBB-UHFFFAOYSA-N
SMILES:O(CCCCCCCCCCCC)C1=CC=C(C(O)=O)C=C1
Synonyms:- 4-(Dodecyloxy)benzoic acid
- 4-(n-Dodecyloxy)benzoic acid
- 4-n-Dodecyloxybenzoic acid
- Benzoic acid, 4-(dodecyloxy)-
- Benzoic acid, p-(dodecyloxy)-
- NSC 411
- p-(Dodecyloxy)benzoic acid
- p-n-Dodecyloxybenzoic acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
4-(Dodecyloxy)benzoic Acid
CAS:Formula:C19H30O3Purity:>98.0%(GC)(T)Color and Shape:White to Almost white powder to crystalMolecular weight:306.454-n-Dodecyloxybenzoic acid, 98%
CAS:4-n-Dodecyloxybenzoic acid is used as an organic chemical synthesis intermediate. This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item cod
Formula:C19H30O3Purity:98%Color and Shape:White, PowderMolecular weight:306.45Benzoic acid, 4-(dodecyloxy)-
CAS:Formula:C19H30O3Purity:97%Color and Shape:SolidMolecular weight:306.43974-(Dodecyloxy)benzoic Acid
CAS:4-(Dodecyloxy)benzoic acid is a white crystalline solid that can be synthesized from triazine, fatty acid, and 4-hydroxyphenylacetic acid. It has been found to be an efficient photosensitizer for the generation of singlet oxygen in organic systems. The photochemical properties of this compound have been studied using FT-IR spectroscopy and light emission and it has been found to emit in the near infrared region. 4-(Dodecyloxy)benzoic acid also has a mesomorphic phase, which can be seen as a change in its optical properties when heated or cooled. This chemical is hydrophobic with low solubility in water.Purity:Min. 95%






