
CAS 231283-82-2
:4-[(2,3-Dihydro-5,6-dimethoxy-1-oxo-1H-inden-2-yl)methyl]-1-(phenylmethyl)pyridinium bromide (1:1)
Description:
4-[(2,3-Dihydro-5,6-dimethoxy-1-oxo-1H-inden-2-yl)methyl]-1-(phenylmethyl)pyridinium bromide (1:1), with CAS number 231283-82-2, is a quaternary ammonium compound characterized by its complex structure, which includes a pyridinium moiety and an indene derivative. This compound typically exhibits properties associated with quaternary ammonium salts, such as solubility in polar solvents and potential antimicrobial activity. The presence of methoxy groups suggests that it may have enhanced lipophilicity, which can influence its biological activity and interaction with cellular membranes. The bromide counterion contributes to its ionic nature, affecting its stability and reactivity. Additionally, the compound may exhibit unique optical properties due to its conjugated systems, making it of interest in various fields, including medicinal chemistry and materials science. Its specific applications and behavior in biological systems would depend on further empirical studies, including its pharmacokinetics and toxicity profile.
Formula:C24H24NO3·Br
InChI:InChI=1S/C24H24NO3.BrH/c1-27-22-14-19-13-20(24(26)21(19)15-23(22)28-2)12-17-8-10-25(11-9-17)16-18-6-4-3-5-7-18;/h3-11,14-15,20H,12-13,16H2,1-2H3;1H/q+1;/p-1
InChI key:InChIKey=SJDPCJIYDYUWEN-UHFFFAOYSA-M
SMILES:O=C1C=2C(=CC(OC)=C(OC)C2)CC1CC=3C=C[N+](CC4=CC=CC=C4)=CC3.[Br-]
Synonyms:- Pyridinium, 4-[(2,3-dihydro-5,6-dimethoxy-1-oxo-1H-inden-2-yl)methyl]-1-(phenylmethyl)-, bromide (1:1)
- 1-Benzyl-4-(5,6-dimethoxy-1-oxoindan-2-yl)methylpyridinium Bromide
- 4-[(2,3-Dihydro-5,6-dimethoxy-1-oxo-1H-inden-2-yl)methyl]-1-(phenylmethyl)pyridinium bromide (1:1)
- Pyridinium, 4-[(2,3-dihydro-5,6-dimethoxy-1-oxo-1H-inden-2-yl)methyl]-1-(phenylmethyl)-, bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Donepezil EP Impurity E Bromide
CAS:Formula:C24H24NO3·BrColor and Shape:Off-White SolidMolecular weight:374.46 79.901-Benzyl-4-(5,6-dimethoxy-1-oxoindan-2-yl)methylpyridinium Bromide
CAS:Controlled ProductApplications Donepezil impurity.
References Reddy, K., et al.: J. Pharm. Biomed. Anal., 35, 1047 (2004), Nakashima, K., et al.: J. Pharm. Biomed. Anal., 41, 201 (2006),Formula:C24H24NO3·BrColor and Shape:NeatMolecular weight:454.356


