CAS 2313-65-7
:3-Methyl-2-hexanol
Description:
3-Methyl-2-hexanol is an organic compound classified as a secondary alcohol, characterized by its six-carbon chain and a hydroxyl (-OH) functional group. Its molecular formula is C7H16O, indicating the presence of seven carbon atoms, sixteen hydrogen atoms, and one oxygen atom. The structure features a methyl group attached to the third carbon of a hexanol chain, which contributes to its unique properties. This compound is typically a colorless liquid with a characteristic odor and is soluble in organic solvents but has limited solubility in water due to its hydrophobic hydrocarbon chain. 3-Methyl-2-hexanol is used in various applications, including as a solvent and in the synthesis of other chemical compounds. It exhibits moderate volatility and can be flammable, necessitating careful handling and storage. Additionally, like many alcohols, it can participate in various chemical reactions, including oxidation and esterification, making it a versatile compound in organic chemistry. Safety data sheets should be consulted for specific handling and exposure guidelines.
Formula:C7H16O
InChI:InChI=1S/C7H16O/c1-4-5-6(2)7(3)8/h6-8H,4-5H2,1-3H3
InChI key:InChIKey=IRLSKJITMWPWNY-UHFFFAOYSA-N
SMILES:C(CCC)(C(C)O)C
Synonyms:- 3-Methyl-2-hexanol
- NSC 93810
- 2-Hexanol, 3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
