CAS 23130-22-5

5,6-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one

Description:

5,6-Dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one, also known by its CAS number 23130-22-5, is a flavonoid compound characterized by its chromone backbone, which features multiple hydroxyl and methoxy functional groups. This compound exhibits antioxidant properties, attributed to the presence of hydroxyl groups that can donate electrons and neutralize free radicals. Its structural features suggest potential biological activities, including anti-inflammatory and anticancer effects, making it of interest in pharmacological research. The methoxy group enhances its lipophilicity, potentially influencing its bioavailability and interaction with biological membranes. Additionally, the presence of the phenolic moiety contributes to its reactivity and ability to form complexes with metal ions. Overall, this compound's unique structure and functional groups position it as a valuable subject for further studies in medicinal chemistry and natural product research.

Formula: C₁₆H₁₂O₆

InChI: InChI=1/C16H12O6/c1-21-13-7-12-14(16(20)15(13)19)10(18)6-11(22-12)8-2-4-9(17)5-3-8/h2-7,17,19-20H,1H3

SMILES: COc1cc2c(c(=O)cc(c3ccc(cc3)O)o2)c(c1O)O

Synonyms:

• 4H-1-Benzopyran-4-one, 5,6-dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-

5,6-Dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one

CAS: 23130-22-5

5,6-Dihydroxy-2-(4-hydroxyphenyl)-7-methoxy-4H-chromen-4-one

Purity: 98%

Molecular weight: 300.27g/mol

Ref: 54-OR1063042

Sorbifolin

CAS: 23130-22-5

Sorbifolin is a flavone glucoside from Pterogyne nitens with myeloperoxidase inhibition (IC50: 19.2 nM) and radical scavenging effects.

Formula: C₁₆H₁₂O₆

Purity: 98.42%

Color and Shape: Solid

Molecular weight: 300.26

Ref: TM-T75618

Ladanetin

CAS: 23130-22-5

Formula: C₁₆H₁₂O₆

Purity: 95%~99%

Molecular weight: 300.266

Ref: BP-BP5446

Scutellarein 7-methyl ether

CAS: 23130-22-5

Scutellarein 7-methyl ether is a naturally occurring flavone derivative, which is primarily sourced from various plant species within the genus Scutellaria. These plants are rich in flavonoids and have been studied extensively for their diverse biochemical properties. The mode of action of Scutellarein 7-methyl ether involves its ability to act as an antioxidant, neutralizing free radicals and reducing oxidative stress at the cellular level. This compound has been observed to interfere with various enzymatic pathways, contributing to its potential therapeutic effects.

Formula: C₁₆H₁₂O₆

Purity: Min. 95%

Color and Shape: Powder

Molecular weight: 300.26 g/mol

Ref: 3D-FS69731