CymitQuimica logo

CAS 23131-73-9

:

Benzene, 1-chloro-4-(chloromethyl)-2-(trifluoromethyl)-

Description:
Benzene, 1-chloro-4-(chloromethyl)-2-(trifluoromethyl)-, also known by its CAS number 23131-73-9, is a chlorinated aromatic compound characterized by the presence of a benzene ring substituted with a trifluoromethyl group and two chlorinated groups. The trifluoromethyl group (-CF3) is known for its strong electron-withdrawing properties, which can significantly influence the reactivity and stability of the compound. The chloromethyl group (-CH2Cl) adds to the compound's reactivity, making it a potential intermediate in organic synthesis. This compound is typically colorless to pale yellow and may have a distinct odor. It is important to handle it with care due to its potential toxicity and environmental impact. The presence of multiple halogen substituents can also affect its physical properties, such as solubility and boiling point. Overall, this compound is of interest in various chemical applications, including pharmaceuticals and agrochemicals, due to its unique structural features and reactivity.
Formula:C8H5Cl2F3
InChI:InChI=1S/C8H5Cl2F3/c9-4-5-1-2-7(10)6(3-5)8(11,12)13/h1-3H,4H2
InChI key:NREUBTUYADXMHQ-UHFFFAOYSA-N
SMILES:C1=CC(=C(C=C1CCl)C(F)(F)F)Cl
Synonyms:
  • 3-Trifluoromethyl-4-Chlorobenzylchloride
  • 3-Trifluoromethyl-4-Chlorobenzyl Chloride
  • 4-Chloro-3-(trifluoromethyl)benzyl chloride
Found 4 products.