CymitQuimica logo

CAS 23132-67-4

:

4-Pyrimidinamine,6-methoxy-2-methyl-

Description:
4-Pyrimidinamine, 6-methoxy-2-methyl- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic ring containing two nitrogen atoms at positions 1 and 3. This compound features an amino group (-NH2) at the 4-position, a methoxy group (-OCH3) at the 6-position, and a methyl group (-CH3) at the 2-position of the pyrimidine ring. These functional groups contribute to its chemical reactivity and potential biological activity. The presence of the amino group suggests that it may participate in hydrogen bonding and act as a base, while the methoxy and methyl groups can influence its solubility and lipophilicity. The compound may be of interest in medicinal chemistry due to its structural features, which could be relevant for interactions with biological targets. Additionally, its CAS number, 23132-67-4, allows for easy identification in chemical databases and literature. Overall, this compound exemplifies the diverse chemistry associated with substituted pyrimidines.
Formula:C6H9N3O
InChI:InChI=1S/C6H9N3O/c1-4-8-5(7)3-6(9-4)10-2/h3H,1-2H3,(H2,7,8,9)
InChI key:WELGWPHSNIOMLT-UHFFFAOYSA-N
SMILES:CC1=NC(=CC(=N1)OC)N
Synonyms:
  • Pyrimidine,4-amino-6-methoxy-2-methyl- (8CI)
  • 4-Amino-6-methoxy-2-methylpyrimidine
Found 4 products.