CAS 23135-16-2
:1-chloro-4-(1,2-dibromoethyl)benzene
Description:
1-Chloro-4-(1,2-dibromoethyl)benzene, with the CAS number 23135-16-2, is an organic compound characterized by its aromatic structure, which includes a benzene ring substituted with a chlorine atom and a 1,2-dibromoethyl group. This compound is typically a colorless to pale yellow liquid or solid, depending on the temperature and purity. It exhibits moderate solubility in organic solvents, such as dichloromethane and ether, while being less soluble in water due to its hydrophobic aromatic nature. The presence of halogen substituents (chlorine and bromine) contributes to its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions. Additionally, the compound may have applications in organic synthesis and as an intermediate in the production of other chemical entities. However, due to the presence of bromine, it may also pose environmental and health risks, necessitating careful handling and disposal in accordance with safety regulations.
Formula:C8H7Br2Cl
InChI:InChI=1/C8H7Br2Cl/c9-5-8(10)6-1-3-7(11)4-2-6/h1-4,8H,5H2
SMILES:c1cc(ccc1C(CBr)Br)Cl
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
1-Chloro-4-(1,2-dibromoethyl)benzene
CAS:Formula:C8H7Br2ClColor and Shape:SolidMolecular weight:298.4022
