CymitQuimica logo

CAS 23135-50-4

:

5-{[(Benzyloxy)carbonyl]amino}pentanoic acid

Description:
5-{[(Benzyloxy)carbonyl]amino}pentanoic acid, also known by its CAS number 23135-50-4, is an organic compound characterized by its structure, which includes a pentanoic acid backbone with an amino group and a benzyloxycarbonyl protecting group. This compound typically appears as a white to off-white solid and is soluble in polar organic solvents. It is often utilized in peptide synthesis and as an intermediate in organic synthesis due to its functional groups, which allow for various chemical reactions, including amide bond formation. The presence of the benzyloxycarbonyl group provides stability and protection to the amino group during synthetic processes. Additionally, this compound may exhibit biological activity, making it of interest in pharmaceutical research. Its properties, such as melting point, boiling point, and reactivity, can vary based on environmental conditions and the presence of other reagents. Overall, 5-{[(Benzyloxy)carbonyl]amino}pentanoic acid serves as a valuable building block in the field of medicinal chemistry and peptide development.
Formula:C13H17NO4
InChI:InChI=1/C13H17NO4/c15-12(16)8-4-5-9-14-13(17)18-10-11-6-2-1-3-7-11/h1-3,6-7H,4-5,8-10H2,(H,14,17)(H,15,16)
InChI key:QYYPKLYDFCYGPG-UHFFFAOYSA-N
SMILES:c1ccc(cc1)COC(=NCCCCC(=O)O)O
Synonyms:
  • Pentanoic Acid, 5-[[(Phenylmethoxy)Carbonyl]Amino]-
Found 6 products.