CAS 23141-61-9: 6-Methyl-5-nitroquinoline

Description:6-Methyl-5-nitroquinoline is an organic compound belonging to the class of quinolines, which are bicyclic aromatic compounds containing a nitrogen atom in the ring structure. This particular compound features a methyl group at the 6-position and a nitro group at the 5-position of the quinoline ring, contributing to its unique chemical properties. It is typically characterized by its yellow to orange crystalline appearance and exhibits moderate solubility in organic solvents. The presence of the nitro group enhances its reactivity, making it a potential candidate for various chemical reactions, including electrophilic substitutions. Additionally, 6-Methyl-5-nitroquinoline may exhibit biological activity, which has drawn interest in medicinal chemistry for potential applications in drug development. Its molecular structure allows for interactions with biological targets, and it may serve as a precursor in the synthesis of other complex organic molecules. As with many nitro compounds, it is essential to handle it with care due to potential toxicity and environmental considerations.

Formula:C₁₀H₈N₂O₂

InChI:InChI=1S/C10H8N2O2/c1-7-4-5-9-8(3-2-6-11-9)10(7)12(13)14/h2-6H,1H3

InChI key:InChIKey=CENBTULRDDPOGR-UHFFFAOYSA-N

SMILES:O=N(=O)C1=C2C=CC=NC2=CC=C1C

Synonyms:
5-Nitro-6-methylquinoline
6-Methyl-5-Nitro-Isoquinoline
Nsc 162892
Quinoline, 6-methyl-5-nitro-
6-Methyl-5-nitroquinoline

Found 4 products.

Product data	Purity	Price range	Estimated delivery
Quinoline, 6-methyl-5-nitro- REF: IN-DA002MC0CAS: 23141-61-9	98%	27.00 €~571.00 €	Mon 14 Apr 25
6-Methyl-5-nitroquinoline REF: 54-OR22094CAS: 23141-61-9	- - -	47.00 €	Tue 15 Apr 25
6-Methyl-5-nitroquinoline REF: 10-F379106CAS: 23141-61-9	95.0%	To inquire	Thu 24 Apr 25
6-Methyl-5-nitroquinoline REF: 3D-YAA14161CAS: 23141-61-9	Min. 95%	- - -	Discontinued product