CAS 23145-05-3

5-Chloro-1-benzofuran

Description:

5-Chloro-1-benzofuran is an organic compound characterized by its fused benzene and furan rings, with a chlorine atom substituent at the 5-position of the benzofuran structure. This compound typically appears as a colorless to pale yellow liquid or solid, depending on its purity and form. It is known for its aromatic properties, which contribute to its stability and reactivity. The presence of the chlorine atom introduces unique electronic effects, influencing its reactivity in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. 5-Chloro-1-benzofuran is often utilized in organic synthesis and may serve as an intermediate in the production of pharmaceuticals, agrochemicals, or other fine chemicals. Its solubility characteristics can vary, often being more soluble in organic solvents than in water. Safety data should be consulted for handling and storage, as halogenated compounds can pose health and environmental risks.

Formula: C₈H₅ClO

InChI: InChI=1/C8H5ClO/c9-7-1-2-8-6(5-7)3-4-10-8/h1-5H

SMILES: c1cc2c(cco2)cc1Cl

Synonyms:

• 5-Chlorobenzofuran
• Benzofuran, 5-Chloro-

Benzofuran, 5-chloro-

CAS: 23145-05-3

Formula: C₈H₅ClO

Purity: 97%

Color and Shape: Liquid

Molecular weight: 152.5777

Ref: IN-DA002MCZ

5-Chlorobenzo[b]furan

CAS: 23145-05-3

5-Chlorobenzo[b]furan

Purity: 97%

Molecular weight: 152.58g/mol

Ref: 54-OR909407

5-Chlorobenzofuran

CAS: 23145-05-3

Formula: C₈H₅ClO

Purity: 97%

Molecular weight: 152.58

Ref: 10-F215016

5-Chlorobenzofuran

CAS: 23145-05-3

5-Chlorobenzofuran is a versatile compound that has various applications in different fields. It is commonly used in research as a collagen phosphatase inhibitor and in the synthesis of amides. Additionally, it has been found to interact with epidermal growth factor receptors and affect the metabolism of inulin and fructan.

Formula: C₈H₅ClO

Purity: Min. 95%

Molecular weight: 152.58 g/mol

Ref: 3D-YAA14505