CAS 23147-57-1: 2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol
Description:2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol is an organic compound characterized by its dioxane structure, which features a six-membered ring containing two oxygen atoms. This compound is notable for its four methyl groups attached to the carbon atoms in the ring, contributing to its hydrophobic properties and influencing its solubility in various solvents. The presence of hydroxyl (-OH) groups at the 2 and 5 positions enhances its polarity, making it more soluble in polar solvents like water. This compound is typically used in organic synthesis and may serve as an intermediate in the production of other chemical substances. Its molecular structure allows for potential applications in pharmaceuticals and materials science. Safety data indicates that, like many organic compounds, it should be handled with care, as it may pose health risks if ingested or inhaled. Overall, 2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol is a versatile compound with unique chemical properties that make it valuable in various chemical applications.
Formula:C8H16O4
InChI:InChI=1S/C8H16O4/c1-5-7(3,9)12-6(2)8(4,10)11-5/h5-6,9-10H,1-4H3
InChI key:InChIKey=DFMGATPNJMFDCR-UHFFFAOYSA-N
SMILES:OC1(OC(C)C(O)(OC1C)C)C
- Synonyms:
- 1,4-Dioxane-2,5-diol, 2,3,5,6-tetramethyl-
- 2,3,5,6-Tetramethyl-1,4-dioxane-2,5-diol
- 2,5-Dihydroxy-2,3,5,6-tetramethyl-1,4-dioxane
- p-Dioxane-2,5-diol, 2,3,5,6-tetramethyl-

Acetoin (May exist as crystalline dimer)
Ref: 3B-H0225
25g | 38.00 € | ||
500g | 310.00 € |

1,4-Dioxane-2,5-diol, 2,3,5,6-tetramethyl-
Ref: IN-DA002MDA
25g | 34.00 € | ||
500g | 140.00 € |

Ref: 54-OR1028342
25g | 32.00 € | ||
100g | 45.00 € | ||
25kg | 2,986.00 € | ||
500g | 117.00 € | ||
2.5kg | 342.00 € |

Acetoin, 96%, may exist as mixture of monomer and dimer
Ref: AC-41195
100g | To inquire | ||
500g | 240.00 € |