CAS 23153-74-4

1,4-Dioxaspiro[4.4]nonane-6-methanol

Description:

1,4-Dioxaspiro[4.4]nonane-6-methanol, identified by its CAS number 23153-74-4, is a chemical compound characterized by its unique spirocyclic structure, which includes a dioxane ring fused to a nonane framework. This compound features two ether oxygen atoms within the dioxane moiety and a hydroxymethyl group (-CH2OH) at the 6-position of the spiro system. The presence of the hydroxymethyl group contributes to its potential solubility in polar solvents and may influence its reactivity and interactions with other chemical species. The spiro structure imparts rigidity to the molecule, which can affect its conformational properties and steric interactions. 1,4-Dioxaspiro[4.4]nonane-6-methanol may exhibit interesting biological activities and could be of interest in medicinal chemistry or materials science. However, specific applications and detailed properties such as melting point, boiling point, and spectral data would require further investigation or experimental data for comprehensive understanding.

Formula: C₈H₁₄O₃

InChI: InChI=1S/C8H14O3/c9-6-7-2-1-3-8(7)10-4-5-11-8/h7,9H,1-6H2

InChI key: InChIKey=QKBNMPDZDDIKRD-UHFFFAOYSA-N

SMILES: C(O)C1C2(CCC1)OCCO2

Synonyms:

• (1,4-Dioxaspiro[4.4]non-6-yl)methanol
• 1,4-Dioxaspiro[4.4]nonan-9-ylmethanol
• 1,4-Dioxaspiro[4.4]nonane-6-methanol

(1,4-Dioxa-spiro[4.4]non-6-yl)-methanol

CAS: 23153-74-4

Formula: C₈H₁₄O₃

Molecular weight: 158.1950

Ref: IN-DA002MDO

(1,4-Dioxa-spiro[4.4]non-6-yl)-methanol

CAS: 23153-74-4

(1,4-Dioxa-spiro[4.4]non-6-yl)-methanol

Purity: 90%

Molecular weight: 158.19g/mol

Ref: 54-OR912514