CAS 23169-33-7

2-amino-9-(2-hydroxyethyl)-3,9-dihydro-6H-purin-6-one

Description:

2-amino-9-(2-hydroxyethyl)-3,9-dihydro-6H-purin-6-one, also known by its CAS number 23169-33-7, is a purine derivative characterized by its structural features that include an amino group and a hydroxyethyl side chain. This compound is part of the broader category of nucleobases, which are essential components of nucleic acids. It exhibits properties typical of purines, such as the ability to participate in hydrogen bonding, which is crucial for base pairing in DNA and RNA. The presence of the hydroxyethyl group enhances its solubility in polar solvents, making it more bioavailable. Additionally, the amino group contributes to its reactivity and potential interactions with other biomolecules. This compound may have implications in biochemical research, particularly in studies related to nucleic acid metabolism and cellular signaling pathways. Its unique structure allows it to potentially serve as a building block for more complex molecules or as a therapeutic agent in various biological applications.

Formula: C₇H₉N₅O₂

InChI: InChI=1/C7H9N5O2/c8-7-10-5-4(6(14)11-7)9-3-12(5)1-2-13/h3,13H,1-2H2,(H3,8,10,11,14)

SMILES: C(CO)n1cnc2c1[nH]c(=N)nc2O

9-(2-Hydroxyethyl)guanine

CAS: 23169-33-7

Formula: C₇H₉N₅O₂

Purity: 99%

Color and Shape: Solid

Molecular weight: 195.1787

Ref: IN-DA002MFW

Aciclovir (Acyclovir) EP Impurity P

CAS: 23169-33-7

Formula: C₇H₉N₅O₂

Color and Shape: Pale Yellow Solid

Molecular weight: 195.18

Ref: 4Z-A-0413

Aciclovir EP Impurity P

CAS: 23169-33-7

Formula: C₇H₉N₅O₂

Molecular weight: 195.18

Ref: ST-EA-CP-A8016

9-(2-Hydroxyethyl)guanine

Controlled Product

CAS: 23169-33-7

Impurity Aciclovir EP Impurity P
Applications 9-(2-Hydroxyethyl)guanine (Aciclovir EP Impurity P) is an impurity of the antiviral agent Acyclovir (A192400). 9-(2-Hydroxyethyl)guanine is a nucleoside phosphotransferase acceptor.
References Kamimura, A. et al.: Agric. Biol. Chem., 37, 2037 (1973);

Formula: C₇H₉N₅O₂

Color and Shape: Beige

Molecular weight: 195.18

Ref: TR-H942035